CAS 36965-71-6: 5101520-tetrakis(pentafluorophenyl)porph yrin fe(iii) cl com
Description:5101520-tetrakis(pentafluorophenyl)porphyrin iron(III) chloride, with the CAS number 36965-71-6, is a synthetic coordination compound characterized by its complex structure featuring a porphyrin ring coordinated to an iron(III) ion and chloride. The porphyrin moiety is substituted with four pentafluorophenyl groups, which significantly enhance its electron-withdrawing properties and solubility in organic solvents. This compound exhibits distinct optical properties, including strong absorption in the visible region, making it useful in various applications such as photodynamic therapy, catalysis, and as a dye in organic electronics. The presence of the iron(III) center allows for redox activity, which can be exploited in electrochemical applications. Additionally, the pentafluorophenyl substituents contribute to the compound's stability and reactivity, influencing its interactions with other molecules. Overall, this compound is notable for its unique structural features and potential applications in advanced materials and medicinal chemistry.
Formula:C44H8ClF20FeN4
InChI:InChI=1/C44H8F20N4.ClH.Fe/c45-25-21(26(46)34(54)41(61)33(25)53)17-9-1-2-10(65-9)18(22-27(47)35(55)42(62)36(56)28(22)48)12-5-6-14(67-12)20(24-31(51)39(59)44(64)40(60)32(24)52)16-8-7-15(68-16)19(13-4-3-11(17)66-13)23-29(49)37(57)43(63)38(58)30(23)50;;/h1-8H;1H;/q-2;;+3/p-1/b17-9+,17-11+,18-10+,18-12+,19-13+,19-15+,20-14+,20-16+;;/rC44H8ClF20FeN4/c45-66-69-13-5-6-15(69)19(23-29(50)37(58)43(64)38(59)30(23)51)11-3-4-12(68-11)20(24-31(52)39(60)44(65)40(61)32(24)53)16-8-7-14(70(16)66)18(22-27(48)35(56)42(63)36(57)28(22)49)10-2-1-9(67-10)17(13)21-25(46)33(54)41(62)34(55)26(21)47/h1-8H/b17-9+,17-13+,18-10+,18-14+,19-11+,19-15+,20-12+,20-16+
- Synonyms:
- 5,10,15,20-Tetrakis(pentafluorophenyl)porphyrin iron(III) chloride

Iron,chloro[5,10,15,20-tetrakis(pentafluorophenyl)-21H,23H-porphinato(2-)-kN21,kN22,kN23,kN24]-, (SP-5-12)-
Ref: IN-DA007CJO
100mg | 697.00 € |

Fe(III) meso-Tetra(Pentafluorophenyl) Porphine Chloride
Ref: FT-T41158
50mg | To inquire | ||
100mg | To inquire | ||
250mg | To inquire | ||
500mg | To inquire |

5,10,15,20-Tetrakis(pentafluorophenyl)-21H,23H-porphyrin iron(III) chloride
Ref: 3D-FT99769
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |