CAS 36967-94-9

2-[(4-chlorophenyl)sulfonyl]acetamide

Description:

2-[(4-Chlorophenyl)sulfonyl]acetamide, with the CAS number 36967-94-9, is an organic compound characterized by its sulfonamide functional group attached to an acetamide moiety. This compound features a 4-chlorophenyl group, which contributes to its chemical properties and potential biological activity. It is typically a white to off-white solid, and its solubility can vary depending on the solvent used, often being more soluble in polar solvents. The presence of the sulfonyl group enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. This compound may exhibit biological activity, potentially serving as a pharmaceutical intermediate or in the development of therapeutic agents. Its structural characteristics suggest it may interact with biological targets, although specific biological activities would require further investigation. Safety data should be consulted for handling and usage, as compounds with sulfonamide groups can sometimes exhibit toxicity or allergenic properties. Overall, 2-[(4-chlorophenyl)sulfonyl]acetamide is a compound of interest in both synthetic and medicinal chemistry.

Formula: C₈H₈ClNO₃S

InChI: InChI=1/C8H8ClNO3S/c9-6-1-3-7(4-2-6)14(12,13)5-8(10)11/h1-4H,5H2,(H2,10,11)

SMILES: c1cc(ccc1Cl)S(=O)(=O)CC(=N)O

2-(4-Chlorobenzenesulphonyl)acetamide

CAS: 36967-94-9

2-(4-Chlorobenzenesulphonyl)acetamide

Purity: ≥95%

Molecular weight: 233.67g/mol

Ref: 54-OR60022