CAS 36969-89-8
:Dimethyl P-(2-oxoheptyl)phosphonate
Description:
Dimethyl P-(2-oxoheptyl)phosphonate, with the CAS number 36969-89-8, is an organophosphorus compound characterized by its phosphonate functional group. This substance typically appears as a colorless to pale yellow liquid and is soluble in organic solvents. It features a dimethyl ester structure, which contributes to its reactivity and potential applications in various chemical processes. The presence of the 2-oxoheptyl group indicates that it has a carbon chain with a ketone functional group, which can influence its biological activity and interactions. Dimethyl P-(2-oxoheptyl)phosphonate is often studied for its potential use in agricultural applications, particularly as a pesticide or herbicide, due to its ability to affect biological systems. Additionally, it may serve as an intermediate in the synthesis of other chemical compounds. As with many organophosphorus compounds, safety precautions are essential when handling this substance, as it may exhibit toxicity and environmental persistence. Proper storage and disposal methods should be followed to mitigate any potential risks.
Formula:C9H19O4P
InChI:InChI=1S/C9H19O4P/c1-4-5-6-7-9(10)8-14(11,12-2)13-3/h4-8H2,1-3H3
InChI key:InChIKey=LQZCYXCHWNQBKX-UHFFFAOYSA-N
SMILES:P(CC(CCCCC)=O)(OC)(OC)=O
Synonyms:- Dimethyl P-(2-oxoheptyl)phosphonate
- Dimethyl (2-oxoheptyl)phosphonate
- Phosphonic acid, P-(2-oxoheptyl)-, dimethyl ester
- Phosphonic acid, (2-oxoheptyl)-, dimethyl ester
- Dimethyl 2-oxoheptanephosphonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Dimethyl (2-oxoheptyl)phosphonate
CAS:Formula:C9H19O4PPurity:95%Color and Shape:LiquidMolecular weight:222.2185Dimethyl (2-oxohept-1-yl)phosphonate
CAS:Dimethyl (2-oxohept-1-yl)phosphonateFormula:C9H19O4PPurity:98%Color and Shape: clear. colourless to sightly yellow liquidMolecular weight:222.21852g/molDimethyl 2-oxoheptylphosphonate
CAS:Formula:C9H19O4PPurity:≥ 97.0%Color and Shape:Light yellow liquidMolecular weight:222.22Dimethyl (2-Oxoheptyl)phosphonate
CAS:Controlled ProductApplications Dimethyl (2-Oxoheptyl)phosphonate is a useful synthetic intermediate, and is used as a reagent to synthesize Caffeic acid (C080000) derivatives, which function as 5-lipoxygenase, 12-lipoxygenase, and prostaglandin synthase inhibitors.
References Sugiura, M., et al.: Chem. Pharm. Bull., 37, 1039 (1989)Formula:C9H19O4PColor and Shape:YellowMolecular weight:222.22Dimethyl (2-Oxoheptyl)phosphonate
CAS:Formula:C9H19O4PPurity:>95.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:222.22






