CAS 36974-65-9

3-{[(4-chlorophenyl)sulfonyl]amino}propanoate

Description:

3-{[(4-chlorophenyl)sulfonyl]amino}propanoate, with the CAS number 36974-65-9, is a chemical compound characterized by its sulfonamide functional group, which is linked to a propanoate moiety. This compound features a 4-chlorophenyl group, indicating the presence of a chlorine atom on a phenyl ring, which can influence its biological activity and solubility. The sulfonyl group contributes to the compound's potential as a sulfonamide, a class known for various pharmaceutical applications, including antibacterial and anti-inflammatory properties. The propanoate portion suggests that it may exhibit properties typical of carboxylic acids, such as acidity and the ability to form salts. The overall structure implies that this compound could interact with biological systems, making it of interest in medicinal chemistry. Its specific characteristics, such as solubility, melting point, and reactivity, would depend on the molecular interactions dictated by its functional groups and overall structure.

Formula: C₉H₉ClNO₄S

InChI: InChI=1/C9H10ClNO4S/c10-7-1-3-8(4-2-7)16(14,15)11-6-5-9(12)13/h1-4,11H,5-6H2,(H,12,13)/p-1

SMILES: c1cc(ccc1Cl)S(=O)(=O)NCCC(=O)[O-]

3-{[(4-chlorophenyl)sulfonyl]amino}propanoic acid

CAS: 36974-65-9

Formula: C₉H₁₀ClNO₄S

Purity: 98%

Color and Shape: Solid

Molecular weight: 263.6980

Ref: IN-DA00CJ7Z

3-(4-Chlorophenylsulfonamido)propanoic acid

CAS: 36974-65-9

3-(4-Chlorophenylsulfonamido)propanoic acid

Purity: 98%

Molecular weight: 263.7g/mol

Ref: 54-OR1061977

3-(4-Chlorobenzenesulfonylamino)propionic acid

CAS: 36974-65-9

Formula: C₉H₁₀ClNO₄S

Purity: 95.0%

Molecular weight: 263.69

Ref: 10-F038527