CymitQuimica logo

CAS 36983-32-1

:

Heptanoic acid, 6-methyl-2,4-dioxo-, ethyl ester

Description:
Heptanoic acid, 6-methyl-2,4-dioxo-, ethyl ester, with the CAS number 36983-32-1, is an organic compound characterized by its ester functional group derived from heptanoic acid. This compound features a heptanoic acid backbone, which is a seven-carbon saturated fatty acid, and includes a methyl group at the sixth carbon position, contributing to its branched structure. The presence of two keto groups at the second and fourth positions indicates that it has significant reactivity, particularly in condensation reactions. As an ethyl ester, it is formed through the reaction of heptanoic acid with ethanol, which influences its solubility and volatility. Generally, esters like this compound are known for their pleasant odors and are often used in flavoring and fragrance applications. Additionally, the presence of the dioxo functional groups suggests potential applications in organic synthesis and as intermediates in the production of various chemical compounds. Overall, this compound exhibits properties typical of esters, including moderate polarity and potential for diverse chemical reactivity.
Formula:C10H16O4
InChI:InChI=1S/C10H16O4/c1-4-14-10(13)9(12)6-8(11)5-7(2)3/h7H,4-6H2,1-3H3
InChI key:YYOKAEPCOREILS-UHFFFAOYSA-N
SMILES:CCOC(=O)C(=O)CC(=O)CC(C)C
Found 2 products.