CymitQuimica logo

CAS 36983-58-1

:

(3S)-3-amino-4-hydroxybutanamide

Description:
(3S)-3-amino-4-hydroxybutanamide, also known as L-threonine, is an α-amino acid that plays a crucial role in protein synthesis and is classified as one of the essential amino acids for humans, meaning it must be obtained through diet. This compound features a hydroxyl group (-OH) and an amino group (-NH2) attached to a four-carbon backbone, which contributes to its polar nature and solubility in water. The presence of the hydroxyl group enhances its reactivity and ability to participate in hydrogen bonding, influencing its biochemical interactions. L-threonine is involved in various metabolic processes, including the synthesis of proteins, neurotransmitters, and other biomolecules. It is also important for maintaining proper immune function and is a precursor for the synthesis of other amino acids. In terms of physical properties, it typically exists as a white crystalline solid and is stable under standard conditions. Its applications extend beyond nutrition, as it is also utilized in pharmaceuticals and as a feed additive in livestock to promote growth and health.
Formula:C4H10N2O2
InChI:InChI=1/C4H10N2O2/c5-3(2-7)1-4(6)8/h3,7H,1-2,5H2,(H2,6,8)/t3-/m0/s1
SMILES:C([C@@H](CO)N)C(=N)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.