CAS 3699-67-0
:Triethyl 3-phosphonopropionate
Description:
Triethyl 3-phosphonopropionate, with the CAS number 3699-67-0, is an organophosphorus compound characterized by its phosphonate functional group. It typically appears as a colorless to pale yellow liquid and is soluble in organic solvents such as ethanol and ether, but has limited solubility in water. This compound is known for its role as a reagent in organic synthesis, particularly in the formation of phosphonate esters and as a building block in the synthesis of various bioactive molecules. It exhibits moderate toxicity, which necessitates careful handling and appropriate safety measures during use. The presence of ethyl groups contributes to its volatility and reactivity, making it useful in various chemical reactions, including alkylation and phosphorylation processes. Additionally, triethyl 3-phosphonopropionate can serve as a precursor in the development of agrochemicals and pharmaceuticals, highlighting its significance in both industrial and research applications.
Formula:C9H19O5P
InChI:InChI=1/C9H19O5P/c1-4-12-9(10)7-8-15(11,13-5-2)14-6-3/h4-8H2,1-3H3
SMILES:CCOC(=O)CCP(=O)(OCC)OCC
Synonyms:- Ethyl 3-(diethoxyphosphoryl)propanoate
- Propanoic acid, 3- (diethoxyphosphinyl)-, ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Triethyl 3-Phosphonopropionate
CAS:Formula:C9H19O5PPurity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:238.22Triethyl 3-phosphonopropionate, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C9H19O5PPurity:98%Color and Shape:Liquid, Clear colorlessMolecular weight:238.22Ethyl 3-(diethoxyphosphoryl)propanoate
CAS:Formula:C9H19O5PPurity:95%Color and Shape:LiquidMolecular weight:238.2179Diethyl [2-(ethoxycarbonyl)ethyl]phosphonate
CAS:Diethyl [2-(ethoxycarbonyl)ethyl]phosphonatePurity:95%Molecular weight:238.22g/mol



