CAS 370-16-1

1-(4-fluorophenyl)-3-phenylthiourea

Description:

1-(4-Fluorophenyl)-3-phenylthiourea, with the CAS number 370-16-1, is an organic compound characterized by its thiourea functional group, which consists of a sulfur atom double-bonded to a carbon atom and bonded to two amine groups. This compound features a phenyl group and a para-fluorophenyl group, contributing to its aromatic nature and influencing its chemical reactivity and physical properties. It typically appears as a solid at room temperature and is soluble in organic solvents. The presence of the fluorine atom can enhance the compound's lipophilicity and may affect its biological activity. Thioureas are known for their diverse applications, including in pharmaceuticals and agrochemicals, often acting as intermediates in the synthesis of various biologically active compounds. Additionally, the compound may exhibit interesting properties such as potential antimicrobial or antifungal activity, making it a subject of interest in medicinal chemistry. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with thiourea derivatives.

Formula: C₁₃H₁₁FN₂S

InChI: InChI=1/C13H11FN2S/c14-10-6-8-12(9-7-10)16-13(17)15-11-4-2-1-3-5-11/h1-9H,(H2,15,16,17)

SMILES: c1ccc(cc1)N=C(Nc1ccc(cc1)F)S

Synonyms:

• N-(4-fluorophenyl)-N'-phenylthiourea
• thiourea, N-(4-fluorophenyl)-N'-phenyl-
• 1-(4-Fluorophenyl)-3-phenylthiourea

1-(4-Fluorophenyl)-3-phenylthiourea

CAS: 370-16-1

Formula: C₁₃H₁₁FN₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 246.3032

Ref: IN-DA01DUA4

NSC 191412

CAS: 370-16-1

NSC 191412

Purity: ≥98%

Molecular weight: 246.3g/mol

Ref: 54-BUP09958

NSC 191412

CAS: 370-16-1

NSC 191412 is an organosulfur compound that activates enzymes and dopamine receptors, including acetylcholinesterase.

Formula: C₁₃H₁₁FN₂S

Purity: 98.92%

Color and Shape: Solid

Molecular weight: 246.3

Ref: TM-T4174

1-(4-FLUOROPHENYL)-3-PHENYLTHIOUREA

CAS: 370-16-1

Purity: 98%

Molecular weight: 246.3000031

Ref: 10-F804970