CAS 370-76-3
:1-fluoro-4-(2-phenylethyl)benzene
Description:
1-Fluoro-4-(2-phenylethyl)benzene, with the CAS number 370-76-3, is an organic compound characterized by the presence of a fluorine atom attached to a benzene ring, which is further substituted with a 2-phenylethyl group. This compound belongs to the class of aryl fluorides and exhibits properties typical of aromatic compounds, such as stability and a relatively high boiling point compared to aliphatic compounds. The fluorine atom contributes to its reactivity, influencing its chemical behavior in various reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The presence of the 2-phenylethyl group enhances its hydrophobic character, making it less soluble in water but more soluble in organic solvents. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its structural features allow for potential applications in the synthesis of more complex molecules and in the development of pharmaceuticals or agrochemicals. Overall, 1-fluoro-4-(2-phenylethyl)benzene is a versatile compound with significant implications in organic synthesis and chemical research.
Formula:C14H13F
InChI:InChI=1/C14H13F/c15-14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/h1-5,8-11H,6-7H2
InChI key:LGAWAQNSZFCGMP-UHFFFAOYSA-N
SMILES:c1ccc(cc1)CCc1ccc(cc1)F
Synonyms:- Benzene, 1-fluoro-4-(2-phenylethyl)-
- Bibenzyl, 4-fluoro-
- L-(4-Fluorophenyl)-2-phenylethane
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery