CAS 3700-19-4

N,N-bis(trifluoromethyl)aniline

Description:

N,N-bis(trifluoromethyl)aniline, with the CAS number 3700-19-4, is an organic compound characterized by the presence of two trifluoromethyl groups attached to the nitrogen of an aniline structure. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is known for its high electronegativity due to the trifluoromethyl groups, which can significantly influence its chemical reactivity and physical properties. The presence of these groups enhances its lipophilicity and can affect its solubility in various organic solvents. N,N-bis(trifluoromethyl)aniline is often utilized in the synthesis of pharmaceuticals, agrochemicals, and other fluorinated compounds, owing to its unique electronic properties. Additionally, it may exhibit interesting biological activities, making it a subject of research in medicinal chemistry. However, handling this compound requires caution due to potential toxicity and environmental concerns associated with fluorinated compounds.

Formula: C₈H₅F₆N

InChI: InChI=1/C8H5F6N/c9-7(10,11)15(8(12,13)14)6-4-2-1-3-5-6/h1-5H

SMILES: c1ccc(cc1)N(C(F)(F)F)C(F)(F)F