CAS 3703-53-5
:7-chloro-1-methyl-2-oxo-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-3-yl D-glucopyranosiduronic acid
Description:
7-Chloro-1-methyl-2-oxo-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-3-yl D-glucopyranosiduronic acid, with the CAS number 3703-53-5, is a complex organic compound that belongs to the benzodiazepine class, characterized by its fused benzene and diazepine rings. This compound features a chloro substituent at the 7-position and a methyl group at the 1-position, contributing to its unique chemical properties. The presence of a phenyl group at the 5-position enhances its aromatic character, while the 2-oxo group indicates a carbonyl functionality that can influence reactivity and stability. Additionally, the D-glucopyranosiduronic acid moiety suggests that this compound has glycosidic characteristics, potentially affecting its solubility and biological activity. The overall structure implies that it may exhibit pharmacological properties, possibly related to central nervous system activity, although specific biological effects would require further investigation. Its complex structure and functional groups make it a subject of interest in medicinal chemistry and pharmacology.
Formula:C22H21ClN2O8
InChI:InChI=1/C22H21ClN2O8/c1-25-13-8-7-11(23)9-12(13)14(10-5-3-2-4-6-10)24-19(20(25)29)33-22-17(28)15(26)16(27)18(32-22)21(30)31/h2-9,15-19,22,26-28H,1H3,(H,30,31)/t15-,16-,17+,18-,19?,22?/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Temazepam b-D-Glucuronide, Mixture of Diastereomers
CAS:Controlled Product<p>Applications A glucuronide metabolite of Diazepam.Controlled substance (depressant). Sedative, hypnotic.<br>References Sarteschi, P., et al.: Arzneim.-Forsch., 22, 93 (1972), Schwandt, H.J., et al.: Xenobiotica, 4, 733 (1974), Curry, S.H., et al.: Br. J. Pharmacol., 57, 427 (1976), Heel, R.C., et al.: Drugs, 21, 321 (1981),<br></p>Formula:C22H21ClN2O8Color and Shape:Off-WhiteMolecular weight:476.86Temazepam β-D-Glucuronide, Mixture of Diastereomers (1.0 mg/ml in Methanol)
CAS:Controlled ProductFormula:C22H21ClN2O8Color and Shape:Single SolutionMolecular weight:476.86
