CAS 3703-79-5
:Bamethan
Description:
Bamethan, with the CAS number 3703-79-5, is a chemical compound that belongs to the class of organic compounds known as amines. It is characterized by its structure, which typically includes an amine functional group, contributing to its reactivity and potential applications in various chemical processes. Bamethan is often studied for its pharmacological properties, particularly in the context of its use as a therapeutic agent. Its solubility in water and organic solvents can vary, influencing its behavior in biological systems and industrial applications. The compound may exhibit specific biological activities, making it of interest in medicinal chemistry and drug development. Additionally, safety and handling considerations are essential, as with many amines, due to potential toxicity and reactivity. Overall, Bamethan represents a compound with diverse implications in both research and practical applications, warranting further investigation into its properties and uses.
Formula:C12H19NO2
InChI:InChI=1/C12H19NO2/c1-2-3-8-13-9-12(15)10-4-6-11(14)7-5-10/h4-7,12-15H,2-3,8-9H2,1H3
InChI key:InChIKey=RDUHXGIIUDVSHR-UHFFFAOYSA-N
SMILES:C(CNCCCC)(O)C1=CC=C(O)C=C1
Synonyms:- (±)-Bamethane
- 1-(4-Hydroxyphenyl)-2-(N-butylamino)ethanol
- 1-(4-Hydroxyphenyl)-2-(butylamino)ethanol
- 2-Butylamino-1-(4-Hydroxyphenyl)Ethanol
- 2-Butylamino-1-(p-hydroxyphenyl)ethanol
- 4-[2-(Butylamino)-1-Hydroxyethyl]Phenol
- <span class="text-smallcaps">D</smallcap><smallcap>L</span>-Bamethane
- Bametan
- Benzenemethanol, α-[(butylamino)methyl]-4-hydroxy-
- Benzyl alcohol, α-[(butylamino)methyl]-p-hydroxy-
- Butedrine
- Butylnorsynephrine
- Butylsympatol
- N-Butylnorsynephrine
- N-Butyloctopamine
- Racemic bamethane
- dl-Bamethane
- α-[(Butylamino)methyl]-4-hydroxybenzenemethanol
- Bamethan
- 4-[2-(butylamino)-1-hydroxy-ethyl]phenol
- 1-[p-Hydroxyphenyl]-2-butylaminoethanol
- Benzyl alcohol, α-[(butylamino)methyl]-p-hydroxy- (6CI, 8CI)
- Bamethanum
- Bamethanc
- Bamethan (base and/or unspecified salts)
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
