CAS 37032-15-8
:Sophamide
Description:
Sophamide, with the CAS number 37032-15-8, is a chemical compound that belongs to the class of amides. It is characterized by its structural features, which typically include a carbonyl group (C=O) bonded to a nitrogen atom (N), along with various substituents that can influence its chemical behavior and biological activity. Sophamide is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its properties may include solubility in organic solvents, stability under certain conditions, and the ability to interact with biological targets, making it of interest for research in drug design and development. The compound's specific reactivity, toxicity, and environmental impact would depend on its molecular structure and functional groups. As with many chemical substances, handling and usage should adhere to safety guidelines to mitigate any risks associated with exposure. Further studies and data would be necessary to fully understand its characteristics and applications in various fields.
Formula:C6H14NO4PS2
InChI:InChI=1S/C6H14NO4PS2/c1-9-5-7-6(8)4-14-12(13,10-2)11-3/h4-5H2,1-3H3,(H,7,8)
InChI key:InChIKey=FCUBTKFQDYNIIC-UHFFFAOYSA-N
SMILES:P(SCC(NCOC)=O)(OC)(OC)=S
Synonyms:- Phosphorodithioic acid, S-[2-[(methoxymethyl)amino]-2-oxoethyl] O,O-dimethyl ester
- Phosphorodithioic acid, O,O-dimethyl ester, S-ester with 2-mercapto-N-(methoxymethyl)acetamide
- Acetamide, 2-mercapto-N-(methoxymethyl)-, S-ester with O,O-di-Me phosphorodithioate
- Sophamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Sophamide
CAS:<p>Sophamide is an analog that has been found to be effective as an anticancer agent. It works by inhibiting the activity of kinases, which are enzymes that play a key role in cancer cell growth and survival. Sophamide has been shown to induce apoptosis, or programmed cell death, in human cancer cells. It is a potent inhibitor of protein kinases and has been used in medicinal preparations for the treatment of various types of cancer. Sophamide was first isolated from Chinese urine and has since been extensively studied for its potential as an anticancer drug. Its ability to inhibit tumor growth makes it a promising candidate for further research into cancer treatments.</p>Formula:C6H14NO4PS2Purity:Min. 95%Molecular weight:259.3 g/mol
