CymitQuimica logo

CAS 37046-82-5

:

1,4-diphenyl-1,2,4,5-tetrazinane

Description:
1,4-Diphenyl-1,2,4,5-tetrazinane is a chemical compound characterized by its unique tetrazine ring structure, which consists of four nitrogen atoms and two phenyl groups attached to the 1 and 4 positions of the tetrazine framework. This compound is part of a class of heterocyclic compounds known for their potential applications in materials science, pharmaceuticals, and as intermediates in organic synthesis. The presence of multiple nitrogen atoms contributes to its stability and reactivity, making it a subject of interest in various chemical reactions, including cycloadditions and as a building block for more complex molecules. Its CAS number, 37046-82-5, allows for easy identification in chemical databases. The compound may exhibit interesting electronic properties due to the conjugation between the phenyl groups and the tetrazine ring, which can influence its optical and electronic behavior. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for detailed applications and handling guidelines.
Formula:C14H16N4
InChI:InChI=1/C14H16N4/c1-3-7-13(8-4-1)17-11-16-18(12-15-17)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2
SMILES:c1ccc(cc1)N1CNN(CN1)c1ccccc1
Synonyms:
  • 1,2,4,5-Tetrazine, Hexahydro-1,4-Diphenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.