CAS 3705-21-3
:5-hydroxy-1H-indole-3-carboxylic acid
Description:
5-Hydroxy-1H-indole-3-carboxylic acid, also known as serotonin or 5-hydroxytryptophan, is an indole derivative characterized by its hydroxyl and carboxylic acid functional groups. This compound is a naturally occurring amino acid and is a precursor to the neurotransmitter serotonin, playing a crucial role in various biological processes, including mood regulation and gastrointestinal function. It is typically a white to off-white crystalline solid, soluble in water and alcohol, and exhibits a melting point that varies depending on purity and form. The presence of the hydroxyl group contributes to its ability to form hydrogen bonds, enhancing its solubility and reactivity. In terms of its chemical behavior, it can participate in various reactions typical of carboxylic acids and phenolic compounds, such as esterification and oxidation. Additionally, it has been studied for its potential therapeutic applications, particularly in the treatment of mood disorders and other health conditions related to serotonin levels. Overall, 5-hydroxy-1H-indole-3-carboxylic acid is significant in both biochemistry and pharmacology.
Formula:C9H7NO3
InChI:InChI=1/C9H7NO3/c11-5-1-2-8-6(3-5)7(4-10-8)9(12)13/h1-4,10-11H,(H,12,13)
SMILES:c1cc2c(cc1O)c(c[nH]2)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Hydroxy-1H-indole-3-carboxylic acid
CAS:Formula:C9H7NO3Purity:98%Color and Shape:SolidMolecular weight:177.15681H-Indole-3-carboxylic acid, 5-hydroxy-
CAS:1H-Indole-3-carboxylic acid, 5-hydroxy is a serotonin receptor agonist. It has been shown to inhibit cancer cell growth and induce apoptosis in human leukemia cells. 1H-Indole-3-carboxylic acid, 5-hydroxy inhibits the production of nitric oxide by inhibiting the enzyme nitrite reductase, which is required for the formation of nitric oxide. This compound also inhibits β-carboline alkaloids and amides that are involved in carcinogenesis. 1H-Indole-3-carboxylic acid, 5-hydroxy has potent inhibitory activities against tumor cells with an IC50 value of 0.1 μM and can be used as a chemotherapeutic agent for cancer treatment or prevention of cancer recurrence. An alternative preparative method for 1H-indole carboxylic acid, 5 hydroxy is provided below:Formula:C9H7NO3Purity:Min. 95%Molecular weight:177.16 g/mol



