CAS 3705-27-9
:cyclo(pro-gly)
Description:
Cyclo(pro-gly), also known as cyclo(proline-glycine), is a cyclic dipeptide composed of the amino acids proline and glycine. It features a unique ring structure that contributes to its stability and distinct properties compared to linear peptides. This compound is characterized by its relatively low molecular weight and the presence of a secondary amine in the proline residue, which influences its conformational flexibility. Cyclo(pro-gly) is known for its role in various biological processes, including its potential involvement in signaling pathways and its effects on cellular functions. Additionally, it exhibits interesting solubility characteristics, often being soluble in polar solvents. The cyclic nature of this dipeptide can enhance its resistance to enzymatic degradation, making it a subject of interest in pharmaceutical and biochemical research. Its unique structure may also contribute to specific interactions with receptors or enzymes, highlighting its potential applications in drug design and development.
Formula:C7H10N2O2
InChI:InChI=1/C7H10N2O2/c10-6-4-8-7(11)5-2-1-3-9(5)6/h5H,1-4H2,(H,8,11)/t5-/m0/s1
SMILES:C1C[C@H]2C(=NCC(=O)N2C1)O
Synonyms:- Cyclo(-Gly-Pro)
- (8aS)-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
- (8aS)-octahydropyrrolo[1,2-a]piperazine-1,4-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Cyclo(-Gly-Pro)
CAS:Cyclo(Gly-Pro) has been detected in rat brain. In the passive avoidance test in rats, synthetic cycloprolylglycine showed 76% antiamnesic activity.Formula:C7H10N2O2Purity:> 99%Color and Shape:White PowderMolecular weight:154.17Vildagliptin Impurity 26
CAS:Formula:C7H10N2O2Color and Shape:White To Off-White SolidMolecular weight:154.17(S)-Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
CAS:(S)-Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
Molecular weight:154.1665g/molCyclo(Gly-L-Pro)
CAS:Cyclo(Gly-L-Pro) shows immunomodulatory activity and neuroprotective potential in animal models.Formula:C7H10N2O2Purity:98.48%Color and Shape:SolidMolecular weight:154.17Cyclo(-Gly-Pro)
CAS:Cyclo(-Gly-Pro) is a cyclic peptide that has been shown to be neuroprotective. It acts as an analog of the neurotransmitter glutamate and inhibits the binding of glutamate to its receptors. Cyclo(-Gly-Pro) also blocks the release of serotonin from nerve cells and inhibits the proliferation of nerve cells in culture. Cyclo(-Gly-Pro) has been shown to increase locomotor activity in mice, which may be due to its ability to activate 5-HT2A receptors in the brain.Formula:C7H10N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:154.17 g/mol(S)-Hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
CAS:Formula:C7H10N2O2Purity:98%Molecular weight:154.169








