CAS 37051-00-6

(6R,7R)-7-{[amino(cyclohex-1-en-1-yl)acetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid

Description:

The chemical substance known as "(6R,7R)-7-{[amino(cyclohex-1-en-1-yl)acetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid," with the CAS number 37051-00-6, is a complex bicyclic compound that belongs to the class of thiazolidine derivatives. It features a bicyclic structure that incorporates both sulfur and nitrogen atoms, contributing to its unique chemical properties. The presence of an amino group and a carboxylic acid functional group suggests that it may exhibit both basic and acidic characteristics, which can influence its solubility and reactivity in various environments. The cyclohexene moiety adds to its structural complexity and may affect its biological activity. This compound is of interest in medicinal chemistry, particularly for its potential applications in antibiotic development, as it may exhibit activity against certain bacterial strains. Its stereochemistry, indicated by the (6R,7R) configuration, is crucial for its biological interactions and efficacy. Overall, this compound represents a significant area of study in the development of novel therapeutic agents.

Formula: C₁₆H₂₁N₃O₄S

InChI: InChI=1/C16H21N3O4S/c1-8-7-24-15-11(14(21)19(15)12(8)16(22)23)18-13(20)10(17)9-5-3-2-4-6-9/h5,10-11,15H,2-4,6-7,17H2,1H3,(H,18,20)(H,22,23)/t10?,11-,15-/m1/s1

SMILES: CC1=C(C(=O)O)N2C(=O)[C@H]([C@H]2SC1)N=C(C(C1=CCCCC1)N)O

Cefradine Impurity 1

CAS: 37051-00-6

Formula: C₁₆H₂₁N₃O₄S

Molecular weight: 351.43

Ref: 4Z-C-120004

4’,5’-Dihydrocephradine

Controlled Product

CAS: 37051-00-6

Formula: C₁₆H₂₁N₃O₄S

Color and Shape: Neat

Molecular weight: 351.421

Ref: TR-D446370

4,5-Dihydrocephradine

CAS: 37051-00-6

4,5-Dihydrocephradine is a semisynthetic cephalosporin antibiotic, which is derived from the mold Acremonium. Its primary mode of action is the inhibition of bacterial cell wall synthesis, achieved by binding to penicillin-binding proteins. This binding disrupts the peptidoglycan cross-linking necessary for cell wall integrity, leading to cell lysis and death in susceptible bacteria.

Formula: C₁₆H₂₁N₃O₄S

Purity: Min. 95%

Molecular weight: 351.40 g/mol

Ref: 3D-MBA05100