CAS 37055-53-1

1,3-di-tert-butyl-5-iodobenzene

Description:

1,3-Di-tert-butyl-5-iodobenzene is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with two tert-butyl groups and one iodine atom. The tert-butyl groups, which are bulky and branched, contribute to the compound's steric hindrance, influencing its reactivity and solubility. The iodine substituent introduces a halogen, which can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of more complex molecules. Its physical properties, such as melting point and boiling point, are influenced by the presence of the bulky tert-butyl groups, which can also affect its solubility in different solvents. Additionally, the iodine atom can impart unique electronic properties, making it useful in certain applications, including medicinal chemistry and materials science. Overall, 1,3-di-tert-butyl-5-iodobenzene is a versatile compound with significant implications in synthetic organic chemistry.

Formula: C₁₄H₂₁I

InChI: InChI=1/C14H21I/c1-13(2,3)10-7-11(14(4,5)6)9-12(15)8-10/h7-9H,1-6H3

SMILES: CC(C)(C)c1cc(cc(c1)I)C(C)(C)C

1,3-Di-tert-butyl-5-iodobenzene

CAS: 37055-53-1

Formula: C₁₄H₂₁I

Purity: 98%

Color and Shape: Solid

Molecular weight: 316.2210

Ref: IN-DA01EFMN

1,3-di-tert-Butyl-5-iodobenzene

CAS: 37055-53-1

1,3-di-tert-Butyl-5-iodobenzene

Purity: 99%

Molecular weight: 316.22g/mol

Ref: 54-OR91542

1,3-di-tert-Butyl-5-iodobenzene

CAS: 37055-53-1

Purity: 96%

Molecular weight: 316.2260132

Ref: 10-F607731