CAS 37073-15-7
:1-(methylsulfonyl)-1H-benzotriazole
Description:
1-(Methylsulfonyl)-1H-benzotriazole, with the CAS number 37073-15-7, is an organic compound characterized by its benzotriazole core, which is a five-membered heterocyclic structure containing nitrogen atoms. This compound features a methylsulfonyl group (-SO2CH3) attached to the benzotriazole, which enhances its solubility in polar solvents and contributes to its chemical reactivity. It is typically a white to off-white solid and is known for its applications in various fields, including as a UV stabilizer in plastics and coatings, due to its ability to absorb ultraviolet light and prevent degradation. Additionally, it may exhibit antimicrobial properties, making it useful in agricultural and pharmaceutical applications. The compound's stability under normal conditions, along with its relatively low volatility, makes it suitable for incorporation into formulations where prolonged efficacy is desired. As with many sulfonyl compounds, it may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which can be exploited in synthetic organic chemistry.
Formula:C7H7N3O2S
InChI:InChI=1/C7H7N3O2S/c1-13(11,12)10-7-5-3-2-4-6(7)8-9-10/h2-5H,1H3
SMILES:CS(=O)(=O)n1c2ccccc2nn1
Synonyms:- 1H-1,2,3-benzotriazole, 1-(methylsulfonyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Methylsulfonyl-1H-benzotriazole, 97%
CAS:1-Methylsulfonyl-1H-benzotriazole is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKUFormula:C7H7N3O2SPurity:97%Molecular weight:197.211-Methylsulfonyl-1h-benzotriazole
CAS:Formula:C7H7N3O2SPurity:97%Color and Shape:SolidMolecular weight:197.21441-(Methylsulfonyl)-1H-benzo[d][1,2,3]triazole
CAS:1-(Methylsulfonyl)-1H-benzo[d][1,2,3]triazolePurity:97%Molecular weight:197.22g/mol



