CAS 37082-52-3
:7-pentofuranosyl-7H-tetrazolo[5,1-i]purine
Description:
7-Pentofuranosyl-7H-tetrazolo[5,1-i]purine, with the CAS number 37082-52-3, is a chemical compound that belongs to the class of purine derivatives. This compound features a tetrazole ring fused to a purine structure, which is significant in various biological activities. Its molecular framework includes a pentofuranosyl moiety, indicating the presence of a five-membered sugar ring that is crucial for its biological function, particularly in nucleoside analogs. The tetrazole ring contributes to its potential as a pharmacological agent, as tetrazoles are known for their ability to mimic carboxylic acids and can interact with biological targets. The compound may exhibit properties such as antiviral or anticancer activity, making it of interest in medicinal chemistry. Additionally, its solubility, stability, and reactivity can vary based on environmental conditions, influencing its application in research and therapeutic contexts. Overall, 7-pentofuranosyl-7H-tetrazolo[5,1-i]purine represents a unique structure that combines features of both nucleosides and heterocyclic compounds.
Formula:C10H11N7O4
InChI:InChI=1/C10H11N7O4/c18-1-4-6(19)7(20)10(21-4)16-2-11-5-8(16)12-3-17-9(5)13-14-15-17/h2-4,6-7,10,18-20H,1H2
SMILES:C(C1C(C(C(n2cnc3c2ncn2c3nnn2)O1)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
7-b-D-Ribofuranosyl-7H- tetrazolo[5,1i]purine
CAS:7-b-D-Ribofuranosyl-7H- tetrazolo[5,1i]purine is a novel modified ribonucleoside. It has the ability to activate DNA at the monophosphate level and can be used as a substrate for DNA polymerase and in the synthesis of deoxyribonucleosides. 7-b-D-Ribofuranosyl-7H- tetrazolo[5,1i]purine also has antiviral properties, which may be due to its inhibition of viral RNA synthesis. The compound is also used in anticancer treatment as it inhibits cellular proliferation by inhibiting DNA synthesis.
Purity:Min. 95%
