CAS 37083-37-7: Tetrakisdichlorophenylporphine
Description:Tetrakisdichlorophenylporphine, with the CAS number 37083-37-7, is a synthetic porphyrin compound characterized by its complex structure, which includes a porphyrin core with four dichlorophenyl substituents. This compound exhibits strong absorption in the visible region of the electromagnetic spectrum, making it useful in various applications, including photodynamic therapy and as a dye in solar energy conversion systems. Its unique electronic properties arise from the delocalized π-electron system of the porphyrin ring, which allows for efficient light absorption and energy transfer. Tetrakisdichlorophenylporphine is typically soluble in organic solvents, and its solubility can vary depending on the solvent's polarity. The presence of the dichlorophenyl groups enhances its stability and alters its reactivity, making it a subject of interest in materials science and medicinal chemistry. Additionally, due to its potential biological activity, it is studied for its interactions with biological molecules and its role in various biochemical processes.
Formula:C44H22Cl8N4
InChI:InChI=1/C44H22Cl8N4/c45-21-5-1-6-22(46)37(21)41-29-13-15-31(53-29)42(38-23(47)7-2-8-24(38)48)33-17-19-35(55-33)44(40-27(51)11-4-12-28(40)52)36-20-18-34(56-36)43(32-16-14-30(41)54-32)39-25(49)9-3-10-26(39)50/h1-20,53,56H/b41-29+,41-30+,42-31+,42-33+,43-32+,43-34+,44-35+,44-36+
- Synonyms:
- 5,10,15,20-Tetrakis(2,6-dichlorophenyl)porphine
- 5,10,15,20-Tetrakis(2,6-Dichlorophenyl)Porphyrin