CAS 370865-80-8

1-butyl-1-methylpyrrolidinium [(cyanoimino)methylidene]azanide

Description:

1-Butyl-1-methylpyrrolidinium [(cyanoimino)methylidene]azanide, with the CAS number 370865-80-8, is an ionic liquid characterized by its unique structure and properties. This compound features a pyrrolidinium cation, which contributes to its stability and solubility in various solvents. The presence of the [(cyanoimino)methylidene]azanide anion imparts distinctive reactivity and potential applications in fields such as organic synthesis and catalysis. Ionic liquids like this one are known for their low volatility, which makes them environmentally friendly alternatives to traditional solvents. They often exhibit high thermal stability and can dissolve a wide range of organic and inorganic materials. Additionally, the specific functional groups present in this compound may influence its interactions with other substances, making it useful in various chemical processes. Overall, 1-butyl-1-methylpyrrolidinium [(cyanoimino)methylidene]azanide represents a class of compounds with promising applications in green chemistry and materials science.

Formula: C₁₁H₂₀N₄

InChI: InChI=1/C9H20N.C2N3/c1-3-4-7-10(2)8-5-6-9-10;3-1-5-2-4/h3-9H2,1-2H3;/q+1;-1

Synonyms:

• 1-BUTYL-1-METHYLPYRROLIDINIUM DICYANAMID

1-Butyl-1-methylpyrrolidinium Dicyanamide

CAS: 370865-80-8

Formula: C₁₁H₂₀N₄

Purity: >98.0%(T)

Color and Shape: Colorless to Light orange to Yellow clear liquid

Molecular weight: 208.31

Ref: 3B-B5453

1-butyl-1-methylpyrrolidin-1-ium; [(cyanoimino)methylidene]azanide

CAS: 370865-80-8

Formula: C₁₁H₂₀N₄

Purity: 98%

Color and Shape: Liquid

Molecular weight: 208.3033

Ref: IN-DA00CIJJ

1-Butyl-1-Methylpyrrolidinium Dicyanamide

CAS: 370865-80-8

1-Butyl-1-Methylpyrrolidinium Dicyanamide

Purity: 98%

Molecular weight: 208.3g/mol

Ref: 54-OR1029514