
CAS 37087-94-8
:rel-2-Chloro-5-[[(3R,5S)-3,5-dimethyl-1-piperidinyl]sulfonyl]benzoic acid
Description:
Rel-2-Chloro-5-[[(3R,5S)-3,5-dimethyl-1-piperidinyl]sulfonyl]benzoic acid, with CAS number 37087-94-8, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a chlorine atom and a sulfonamide group linked to a piperidine ring. This compound typically exhibits properties associated with both acidic and basic functional groups, allowing it to participate in various chemical reactions. The presence of the sulfonyl group enhances its solubility in polar solvents, while the piperidine ring contributes to its potential biological activity. The stereochemistry indicated by the (3R,5S) configuration suggests specific spatial arrangements that may influence the compound's interactions with biological targets. Such compounds are often studied for their pharmacological properties, including potential applications in medicinal chemistry. Overall, rel-2-Chloro-5-[[(3R,5S)-3,5-dimethyl-1-piperidinyl]sulfonyl]benzoic acid represents a class of compounds that may have significant implications in drug development and therapeutic applications.
Formula:C14H18ClNO4S
InChI:InChI=1/C14H18ClNO4S/c1-9-5-10(2)8-16(7-9)21(19,20)11-3-4-13(15)12(6-11)14(17)18/h3-4,6,9-10H,5,7-8H2,1-2H3,(H,17,18)/t9-,10+
InChI key:InChIKey=IFXSWTIWFGIXQO-AOOOYVTPNA-N
SMILES:S(=O)(=O)(C1=CC(C(O)=O)=C(Cl)C=C1)N2C[C@H](C)C[C@H](C)C2
Synonyms:- rel-2-Chloro-5-[[(3R,5S)-3,5-dimethyl-1-piperidinyl]sulfonyl]benzoic acid
- CP 18524
- Benzoic acid, 2-chloro-5-[(3,5-dimethyl-1-piperidinyl)sulfonyl]-, cis-
- Benzoic acid, 2-chloro-5-[[(3R,5S)-3,5-dimethyl-1-piperidinyl]sulfonyl]-, rel-
- Tibric acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Tibric acid
CAS:Tibric acid is a hepatic peroxisome proliferator.Formula:C14H18ClNO4SColor and Shape:SolidMolecular weight:331.82
