CAS 3709-18-0
:2,2,5-Trimethyl-1,3-dioxane-4,6-dione
Description:
2,2,5-Trimethyl-1,3-dioxane-4,6-dione, with the CAS number 3709-18-0, is an organic compound characterized by its dioxane structure, which features a six-membered ring containing two oxygen atoms. This compound is a diketone, specifically a derivative of dioxane, and is known for its potential applications in organic synthesis and as an intermediate in the production of various chemical compounds. It typically exhibits a colorless to pale yellow appearance and has a relatively low volatility. The presence of multiple methyl groups contributes to its steric hindrance, influencing its reactivity and solubility in organic solvents. The compound may participate in various chemical reactions, including condensation and substitution reactions, due to the reactivity of its carbonyl groups. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, 2,2,5-trimethyl-1,3-dioxane-4,6-dione is a notable compound in the field of organic chemistry with specific structural and chemical properties.
Formula:C7H10O4
InChI:InChI=1S/C7H10O4/c1-4-5(8)10-7(2,3)11-6(4)9/h4H,1-3H3
InChI key:InChIKey=KJMCAXYHYPDRAV-UHFFFAOYSA-N
SMILES:CC1(C)OC(=O)C(C)C(=O)O1
Synonyms:- 1,3-Dioxane-4,6-dione, 2,2,5-trimethyl-
- 2,2,5-Trimethyl-1,3-dioxan-4,6-dione
- 2,2,5-Trimethyl-m-dioxane-4,6-dione
- Malonic acid, methyl-, cyclic isopropylidene ester
- Malonic acid, methyl-, monoisopropylidene cyclic ester
- Methyl Meldrums acid
- Methyl meldrum's acid
- Methylmalonic acid cyclic isopropylidene ester
- NSC 233870
- cycl-Isopropylidene methylmalonate
- 2,2,5-Trimethyl-1,3-dioxane-4,6-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,2,5-Trimethyl-1,3-dioxane-4,6-dione
CAS:Formula:C7H10O4Purity:97%Color and Shape:SolidMolecular weight:158.15192,2,5-Trimethyl-1,3-dioxane-4,6-dione
CAS:2,2,5-Trimethyl-1,3-dioxane-4,6-dionePurity:98%Molecular weight:158.15g/mol2,2,5-Trimethyl-1,3-dioxane-4,6-dione
CAS:2,2,5-Trimethyl-1,3-dioxane-4,6-dione is a nucleophilic compound that is used in the synthesis of many biologically active molecules. It is activated by various methods and can be used in an introduction strategy to introduce bond cleavage sequences or dehydration reactions. This molecule has been shown to catalyze the dehydration of sulfoxides and carbapenems. 2,2,5-Trimethyl-1,3-dioxane-4,6-dione also has magnetic resonance properties that make it suitable for voltammetry experiments.Formula:C7H10O4Purity:Min. 95%Color and Shape:White PowderMolecular weight:158.15 g/mol2,2,5-Trimethyl-1,3-dioxane-4,6-dione
CAS:Formula:C7H10O4Purity:97%Color and Shape:CrystallineMolecular weight:158.153



