CAS 37095-43-5: (1Z,4Z,9Z,15Z)-5,10,15,20-tetrakis(4-fluorophenyl)-21,23-dihydroporphyrin
Description:(1Z,4Z,9Z,15Z)-5,10,15,20-tetrakis(4-fluorophenyl)-21,23-dihydroporphyrin is a synthetic porphyrin derivative characterized by its complex structure, which includes multiple conjugated double bonds and a central metal-free porphyrin core. This compound features four 4-fluorophenyl substituents, which enhance its electronic properties and solubility in organic solvents. The presence of fluorine atoms can influence the compound's reactivity and photophysical properties, making it potentially useful in applications such as photodynamic therapy, organic photovoltaics, and as a dye in various chemical processes. The stereochemistry indicated by the (1Z,4Z,9Z,15Z) configuration suggests specific geometric arrangements that can affect the compound's interactions with light and other molecules. Additionally, the dihydroporphyrin structure implies that it may exhibit unique redox behavior, which could be exploited in catalysis or as a sensor. Overall, this compound represents a fascinating area of study in the field of organic and medicinal chemistry due to its potential applications and unique properties.
Formula:C44H26F4N4
InChI:InChI=1/C44H26F4N4/c45-29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(46)12-4-26)37-21-23-39(51-37)44(28-7-15-32(48)16-8-28)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(47)14-6-27/h1-24,49,52H/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-
- Synonyms:
- 21H,23H-porphine, 5,10,15,20-tetrakis(4-fluorophenyl)-
- 5,10,15,20-Tetrakis(4-fluorophenyl)porphyrin