CAS 371-11-9

1-(Difluoriodo)-4-methylbenzene

Description:

1-(Difluoriodo)-4-methylbenzene, also known as para-difluoroiodobenzene, is an aromatic compound characterized by a benzene ring substituted with a methyl group and two fluorine atoms, along with an iodine atom. The presence of these substituents influences its chemical properties, making it a polar compound with potential applications in organic synthesis and medicinal chemistry. The difluoroiodo group enhances the reactivity of the benzene ring, allowing for various electrophilic substitution reactions. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. Its molecular structure contributes to its unique physical properties, such as boiling and melting points, which are influenced by the strength of intermolecular forces. Additionally, 1-(Difluoriodo)-4-methylbenzene is of interest in the field of materials science and pharmaceuticals, where it may serve as an intermediate in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound due to its potential toxicity and reactivity.

Formula: C₇H₇F₂I

InChI: InChI=1S/C7H7F2I/c1-6-2-4-7(5-3-6)10(8)9/h2-5H,1H3

InChI key: InChIKey=ROJCSEAEQFJFGO-UHFFFAOYSA-N

SMILES: I(F)(F)C1=CC=C(C)C=C1

Synonyms:

• Benzene, 1-(difluoriodo)-4-methyl-
• 1-(Difluoriodo)-4-methylbenzene
• Iodine, difluoro(4-methylphenyl)-
• Toluene, p-(difluoroiodo)-
• Benzene, methyl-, iodine complex

4-Iodotoluene difluoride

CAS: 371-11-9

Ref: 7W-GK5638

4-Iodotoluenedifluoride

CAS: 371-11-9

4-Iodotoluenedifluoride is a molecule that can be produced by the Friedel-Crafts reaction of iodotoluene with sulfoxides. It has been shown to be a bioactive molecule and an efficient method for the stereoselective synthesis of sulfoxides. 4-Iodotoluenedifluoride is also used in the synthesis of phenoxy compounds, which have been shown to have anti-inflammatory properties. The phenoxy group can be replaced with fluorine, which increases the lipophilicity of these molecules and makes them useful for lipid lowering drugs. These molecules are also capable of inhibiting cholesterol biosynthesis and increasing density lipoprotein (HDL).

Formula: C₇H₇F₂I

Purity: Min. 95%

Molecular weight: 256.03 g/mol

Ref: 3D-FI151200