CAS 371-26-6
:Ethyl 4,4,4-trifluorobutyrate
Description:
Ethyl 4,4,4-trifluorobutyrate is an organic compound characterized by its ester functional group, which is derived from the reaction of 4,4,4-trifluorobutyric acid and ethanol. This compound features a butyrate backbone with three fluorine atoms attached to the fourth carbon, significantly influencing its chemical properties. Ethyl 4,4,4-trifluorobutyrate is typically a colorless liquid with a fruity odor, making it potentially useful in flavoring and fragrance applications. Its molecular structure imparts unique characteristics, such as increased lipophilicity and altered reactivity compared to non-fluorinated esters. The presence of fluorine atoms enhances its stability and can affect its solubility in various solvents. Additionally, this compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and agrochemical research. Safety data indicates that, like many fluorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, ethyl 4,4,4-trifluorobutyrate is a versatile compound with applications in various fields, including organic synthesis and materials science.
Formula:C6H9F3O2
InChI:InChI=1/C6H9F3O2/c1-2-11-5(10)3-4-6(7,8)9/h2-4H2,1H3
SMILES:CCOC(=O)CCC(F)(F)F
Synonyms:- Butanoic acid, 4,4,4-trifluoro-, ethyl ester
- Ethyl 4,4,4-trifluorobutanoate
- Ethyl-4,4,4-trifluorbutanoat
- 4,4,4-Trifluoro-butyric acid ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethyl 4,4,4-Trifluorobutyrate
CAS:Formula:C6H9F3O2Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:170.13Ethyl 4,4,4-trifluorobutyrate, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H9F3O2Purity:98%Color and Shape:Clear colourless, LiquidMolecular weight:170.13Ethyl 4,4,4-trifluorobutyrate
CAS:Formula:C6H9F3O2Purity:97%Color and Shape:LiquidMolecular weight:170.1297Ethyl 4,4,4-trifluorobutyrate
CAS:<p>Ethyl 4,4,4-trifluorobutyrate</p>Formula:C6H9F3O2Purity:98%Color and Shape: clear. colourless liquidMolecular weight:170.13g/molEthyl 4,4,4-trifluorobutyrate
CAS:Formula:C6H9F3O2Purity:96.0%Color and Shape:LiquidMolecular weight:170.131




