CAS 371-34-6
:Ethyl 6-aminohexanoate
Description:
Ethyl 6-aminohexanoate, with the CAS number 371-34-6, is an organic compound that belongs to the class of amino acids and esters. It features a hexanoic acid backbone with an amino group at the sixth carbon position and an ethyl ester functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. Ethyl 6-aminohexanoate is soluble in polar organic solvents and exhibits moderate hydrophilicity due to the presence of the amino group. It is often used in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. The amino group can participate in various chemical reactions, such as acylation and alkylation, making it a versatile intermediate in synthetic chemistry. Additionally, it may exhibit biological activity, which can be of interest in medicinal chemistry. As with many chemical substances, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C8H17NO2
InChI:InChI=1/C8H17NO2/c1-2-11-8(10)6-4-3-5-7-9/h2-7,9H2,1H3
SMILES:CCOC(=O)CCCCCN
Synonyms:- Hexanoic Acid, 6-Amino-, Ethyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ethyl 6-aminohexanoate, 98%
CAS:<p>Ethyl 6-aminohexanoate is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference </p>Formula:C8H17NO2Purity:98%Color and Shape:White to off-white, SolidMolecular weight:159.23


