CAS 371-49-3
:Butyl 2-fluoroacetate
Description:
Butyl 2-fluoroacetate is an organic compound classified as an ester, specifically an acetate, where the butyl group is attached to the oxygen atom of the acetate functional group. It is characterized by its molecular formula, which includes carbon, hydrogen, oxygen, and fluorine atoms. This compound typically appears as a colorless liquid with a fruity odor, making it useful in various applications, including as a solvent and in organic synthesis. Its boiling point and solubility in organic solvents are notable characteristics, influencing its behavior in chemical reactions and applications. Butyl 2-fluoroacetate is also recognized for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the fluorine atom, which can enhance electrophilicity. Safety considerations are important when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate precautions should be taken to minimize exposure. Overall, Butyl 2-fluoroacetate serves as a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals.
Formula:C6H11FO2
InChI:InChI=1S/C6H11FO2/c1-2-3-4-9-6(8)5-7/h2-5H2,1H3
InChI key:InChIKey=FZXXGBGMLALCIH-UHFFFAOYSA-N
SMILES:C(OCCCC)(CF)=O
Synonyms:- Acetic acid, 2-fluoro-, butyl ester
- Acetic acid, fluoro-, butyl ester
- Butyl 2-fluoroacetate
- Fluoroacetic acid n-butyl ester
- n-Butyl fluoroacetate
- Butyl fluoroacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
n-Butyl fluoroacetate
CAS:Formula:C6H11FO2Purity:98.0%Color and Shape:Liquid, ClearMolecular weight:134.15Butyl Fluoroacetate
CAS:Formula:C6H11FO2Purity:>97.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:134.15n-Butyl fluoroacetate
CAS:n-Butyl Fluoroacetate is a divalent hydrocarbon that has been synthesized as an asymmetric synthesis. It has a colorless or pale yellow liquid with a boiling point of 50 °C, which is soluble in organic solvents. n-Butyl Fluoroacetate has been shown to be a polymerization initiator for polyvinyl chloride (PVC) and polyurethane, which are commonly used in the production of plastics. In addition, n-butyl fluoroacetate can also be used as an environmental pollutant due to its ability to deplete ozone, leading to increased levels of ultraviolet radiation.Formula:C6H11FO2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:134.15 g/mol




