CAS 371-78-8
:bis(trifluoromethyl) sulfide
Description:
Bis(trifluoromethyl) sulfide, with the CAS number 371-78-8, is a chemical compound characterized by its unique structure, which includes a sulfur atom bonded to two trifluoromethyl groups. This compound is typically a colorless liquid at room temperature and is known for its strong odor. It is highly polar due to the electronegative fluorine atoms, which contribute to its reactivity and solubility in polar solvents. Bis(trifluoromethyl) sulfide is utilized in various applications, including as a reagent in organic synthesis and in the production of fluorinated compounds. Its chemical stability is notable, but it can undergo reactions typical of sulfides, such as oxidation. Additionally, the presence of trifluoromethyl groups imparts unique electronic properties, making it of interest in materials science and medicinal chemistry. However, safety precautions are necessary when handling this compound, as it can be toxic and poses environmental hazards. Proper storage and disposal methods should be followed to mitigate risks associated with its use.
Formula:C2F6S
InChI:InChI=1/C2F6S/c3-1(4,5)9-2(6,7)8
SMILES:C(F)(F)(F)SC(F)(F)F
Synonyms:- Methane, 1,1'-Thiobis[1,1,1-Trifluoro-
- Sulfide, bis(trifluoromethyl)
- Trifluoro[(trifluoromethyl)sulfanyl]methane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.