CAS 371-83-5
:1,5-Dibromo-1,1,3,3,5,5-hexafluoropentane
Description:
1,5-Dibromo-1,1,3,3,5,5-hexafluoropentane, with the CAS number 371-83-5, is a halogenated organic compound characterized by its unique structure that includes both bromine and fluorine substituents. This compound features a pentane backbone, where bromine atoms are located at the 1 and 5 positions, while the remaining carbon atoms are fully substituted with fluorine atoms. As a result, it exhibits high thermal and chemical stability, making it resistant to degradation. The presence of multiple halogens contributes to its potential applications in various fields, including as a solvent or in specialized chemical syntheses. Additionally, due to its halogen content, it may have implications for environmental and health safety, particularly concerning its persistence and potential bioaccumulation. The compound is typically handled with caution in laboratory settings, adhering to safety protocols to mitigate risks associated with exposure to halogenated compounds. Overall, 1,5-Dibromo-1,1,3,3,5,5-hexafluoropentane is notable for its unique halogenated structure and associated properties.
Formula:C5H4Br2F6
InChI:InChI=1/C5H4Br2F6/c6-4(10,11)1-3(8,9)2-5(7,12)13/h1-2H2
SMILES:C(C(CC(Br)(F)F)(F)F)C(Br)(F)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1,5-Dibromo-1,1,3,3,5,5-hexafluoropentane, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C5H4Br2F6Purity:97%Color and Shape:Clear colorless, LiquidMolecular weight:337.891,5-Dibromo-1,1,3,3,5,5-hexafluoropentane
CAS:1,5-Dibromo-1,1,3,3,5,5-hexafluoropentaneFormula:C5H4Br2F6Purity:97%Color and Shape: clear liquidMolecular weight:337.88g/mol


