CAS 3710-42-7
:7-Hydroxyheptanoic acid
Description:
7-Hydroxyheptanoic acid, with the CAS number 3710-42-7, is a carboxylic acid characterized by the presence of a hydroxyl group (-OH) and a seven-carbon aliphatic chain. This compound features a hydroxyl group located at the seventh carbon of the heptanoic acid backbone, which contributes to its unique properties. It is a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of both the carboxylic acid and hydroxyl functional groups allows for hydrogen bonding, which can influence its solubility in water and organic solvents. 7-Hydroxyheptanoic acid is of interest in various fields, including pharmaceuticals and biochemistry, due to its potential applications in synthesis and as a building block for more complex molecules. Its reactivity can be attributed to the acidic nature of the carboxyl group and the nucleophilic character of the hydroxyl group, making it a versatile compound in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H14O3
InChI:InChI=1/C7H14O3/c8-6-4-2-1-3-5-7(9)10/h8H,1-6H2,(H,9,10)
InChI key:InChIKey=PNAJBOZYCFSQDJ-UHFFFAOYSA-N
SMILES:C(CCCCO)CC(O)=O
Synonyms:- 7-Hydroxyheptanoic acid
- Heptanoic acid, 7-hydroxy-
- 7-Hydroxyheptanoic Acid sodiuM salt
- Omega-hydroxyheptanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7-Hydroxyheptanoic acid
CAS:7-Hydroxyheptanoic acidFormula:C7H14O3Purity:95%Color and Shape: pale yellow liquidMolecular weight:146.18g/mol7-Hydroxyheptanoic acid
CAS:<p>7-Hydroxyheptanoic acid is a fatty acid that has the hydroxyl group on the seventh carbon. It is biosynthesized from the hydroxylation of heptanal, which is catalyzed by a monooxygenase. The hydroxyl group in 7-hydroxyheptanoic acid can be oxidized to form a carboxylic acid (e.g., 7-ketoheptanoic acid). 7-hydroxyheptanoic acid can also be used as a coating material because it has functional groups and is biodegradable and metal ion free.</p>Formula:C7H14O3Purity:Min. 95%Molecular weight:146.18 g/mol
