CymitQuimica logo

CAS 3710-50-7

:

ethyl 5-methoxy-3-methyl-1-benzofuran-2-carboxylate

Description:
Ethyl 5-methoxy-3-methyl-1-benzofuran-2-carboxylate, identified by its CAS number 3710-50-7, is an organic compound belonging to the class of benzofurans. This substance features a benzofuran core structure, which is characterized by a fused benzene and furan ring, contributing to its aromatic properties. The presence of the ethyl ester functional group indicates that it can participate in various chemical reactions typical of esters, such as hydrolysis and transesterification. The methoxy and methyl substituents on the benzofuran ring enhance its lipophilicity and may influence its biological activity. Ethyl 5-methoxy-3-methyl-1-benzofuran-2-carboxylate is of interest in medicinal chemistry and may exhibit pharmacological properties, although specific biological activities would require further investigation. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, this compound represents a unique structure with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C13H14O4
InChI:InChI=1/C13H14O4/c1-4-16-13(14)12-8(2)10-7-9(15-3)5-6-11(10)17-12/h5-7H,4H2,1-3H3
InChI key:DAETWRKPSJXAJB-UHFFFAOYSA-N
SMILES:CCOC(=O)c1c(C)c2cc(ccc2o1)OC
Synonyms:
  • 2-Benzofurancarboxylic Acid, 5-Methoxy-3-Methyl-, Ethyl Ester
  • 5-Methoxy-3-methyl-benzofuran-2-carboxylic acid ethyl ester
Found 5 products.