CAS 37102-74-2
:3-methylbenzene-1,2-dicarboxylate
Description:
3-Methylbenzene-1,2-dicarboxylate, also known as isophthalic acid dimethyl ester, is an organic compound characterized by its aromatic structure featuring a methyl group and two carboxylate ester groups attached to a benzene ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water. The presence of the methyl group and the two ester functionalities contributes to its reactivity, making it useful in various chemical syntheses and applications, including as a building block in the production of polymers and resins. Additionally, it may exhibit moderate toxicity, necessitating appropriate handling and safety precautions during use. Its chemical properties, such as melting point, boiling point, and specific reactivity, can vary based on the purity and specific conditions under which it is studied or utilized.
Formula:C9H6O4
InChI:InChI=1/C9H8O4/c1-5-3-2-4-6(8(10)11)7(5)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13)/p-2
SMILES:Cc1cccc(c1C(=O)[O-])C(=O)[O-]
Synonyms:- 1,2-Benzenedicarboxylic Acid, 3-Methyl-, Ion(2-)
- 3-Methylphthalate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Methylphthalic Acid
CAS:Controlled ProductFormula:C9H8O4Color and Shape:NeatMolecular weight:180.163-Methylphthalic Acid
CAS:3-Methylphthalic Acid is a chemical that is used in the production of polyvinyl chloride. It is produced by the dioxygenation of phthalic anhydride and methanol, which produces 3-methylphthalic acid as well as 1,1-dichloroethane. The chemical can be used as a surfactant in polyvinyl chloride and styrene production processes. 3-Methylphthalic Acid has been shown to have adverse health effects on laboratory animals, including polyvinyl chloride workers who are exposed to it for prolonged periods of time. The chemical can cause irritation and corrosion to skin and eyes, as well as damage to the liver and kidneys.
Formula:C9H8O4Purity:Min. 95%Molecular weight:180.16 g/molRef: 3D-MBA10274
Discontinued product




