CAS 37105-12-7

2,5-Dichloro-3-nitrothiophene

Description:

2,5-Dichloro-3-nitrothiophene is a heterocyclic organic compound characterized by its thiophene ring, which contains both chlorine and nitro substituents. The presence of two chlorine atoms at the 2 and 5 positions, along with a nitro group at the 3 position, contributes to its unique chemical properties and reactivity. This compound typically appears as a solid and is known for its potential applications in organic synthesis and materials science, particularly in the development of electronic materials and agrochemicals. Its structure allows for various chemical reactions, including electrophilic substitutions and nucleophilic attacks, making it a versatile intermediate in synthetic chemistry. Additionally, the presence of the nitro group can enhance the compound's electron-withdrawing properties, influencing its reactivity and interactions with other chemical species. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2,5-Dichloro-3-nitrothiophene is an important compound in the field of organic chemistry with various potential applications.

Formula: C₄HCl₂NO₂S

InChI: InChI=1S/C4HCl2NO2S/c5-3-1-2(7(8)9)4(6)10-3/h1H

InChI key: InChIKey=BFQBMQKCYWOSEN-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=C(Cl)SC1Cl

Synonyms:

• 2,5-Dichloro-3-nitrothiophene
• Thiophene, 2,5-dichloro-3-nitro-

2,5-Dichloro-3-nitrothiophene

CAS: 37105-12-7

2,5-Dichloro-3-nitrothiophene

Formula: C₄HCl₂NO₂S

Purity: ≥95%

Color and Shape: yellow/brown crystals

Molecular weight: 198.03g/mol

Ref: 54-OR72074