CAS 37112-31-5
:Levoglucosenone
Description:
Levoglucosenone, with the CAS number 37112-31-5, is a chemical compound derived from the pyrolysis of cellulose and is classified as a sugar-derived platform chemical. It is a colorless to pale yellow liquid with a characteristic odor. The molecular structure of levoglucosenone features a furan ring, which contributes to its reactivity and potential applications in organic synthesis. This compound is notable for its ability to serve as a precursor for various chemicals and materials, including pharmaceuticals and biofuels. Levoglucosenone exhibits moderate polarity, making it soluble in organic solvents while having limited solubility in water. Its reactivity is influenced by the presence of functional groups, allowing for various chemical transformations. Additionally, levoglucosenone has garnered interest in the field of green chemistry due to its renewable origins and potential to replace petroleum-derived chemicals. Overall, its unique properties and versatility make it a valuable compound in both research and industrial applications.
Formula:C6H6O3
InChI:InChI=1S/C6H6O3/c7-5-2-1-4-3-8-6(5)9-4/h1-2,4,6H,3H2/t4-,6+/m0/s1
InChI key:InChIKey=HITOXZPZGPXYHY-UJURSFKZSA-N
SMILES:O=C1[C@]2(O[C@](CO2)(C=C1)[H])[H]
Synonyms:- (1S)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one
- (1S,5R)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one
- (5R)-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one
- 1,6-Anhydro-3,4-dideoxyhex-3-enopyran-2-ulose
- 6,8-Dioxabicyclo(3.2.1)oct-2-en-4-one, (1S)-
- 6,8-Dioxabicyclo[3.2.1]oct-2-en-4-one, (1S,5R)-
- Brn 4859778
- Ccris 4274
- Levoglucosenone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Levoglucosenone
CAS:Formula:C6H6O3Purity:>96.0%(GC)Color and Shape:White to Yellow to Orange clear liquidMolecular weight:126.11Levoglucosenone
CAS:<p>Levoglucosenone</p>Formula:C6H6O3Purity:≥95%Color and Shape: clear. light yellow liquidMolecular weight:126.11g/molLevoglucosenone
CAS:<p>Levoglucosenone</p>Purity:95%Color and Shape:LiquidMolecular weight:126.11g/molLevoglucosenone
CAS:<p>Levoglucosenone has cytotoxic. It against human hepatocarcinoma cell lines.</p>Formula:C6H6O3Purity:98.9%Color and Shape:SolidMolecular weight:126.11Levoglucosenone
CAS:Controlled Product<p>Applications (-)-Form is a pyrolysis product of cellulose and cellulose-containing materials including pulp and paper waste products.Known as a pyrolytic product of cellulose, its very useful as a chiral source for synthesizing natural products because of its highly functionalized structure, which contains one chiral center. Used as chiral building block in organic synthesis.<br>References Essig, M.G., et al.: Carbohydr. Res., 156, 225 (1986), Taniguchi, T., et al.: Synlett, 971 (1996),<br></p>Formula:C6H6O3Color and Shape:NeatMolecular weight:126.11Levoglucosenone
CAS:<p>Levoglucosenone is a molecule that inhibits the reaction mechanism of glycosidic bond formation. It is used in biochemical research to study reactions that involve surface methodology, such as hydroxyl group formation and zirconium oxide deposition. Levoglucosenone can be used to inhibit the acid formation that occurs during the reaction between nitrite ion and a chiral compound. The reactant solution can be activated by adding levoglucosenone to it, which will then inhibit the reaction. Sample preparation for these types of experiments involves dissolving the reactant solution in water and adding ammonium hydroxide to it, followed by adding a small amount of levoglucosenone.</p>Formula:C6H6O3Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:126.11 g/mol
