CAS 37113-42-1

9-(2-deoxypentofuranosyl)-6-(methylsulfanyl)-9H-purin-2-amine

Description:

9-(2-Deoxypentofuranosyl)-6-(methylsulfanyl)-9H-purin-2-amine, also known by its CAS number 37113-42-1, is a purine derivative that features a 2-deoxypentofuranosyl moiety, which is a sugar component commonly found in nucleotides. This compound is characterized by the presence of a methylsulfanyl group at the 6-position of the purine ring, which can influence its biological activity and solubility. The purine structure is essential in various biological processes, including DNA and RNA synthesis. The compound may exhibit properties typical of nucleosides, such as potential antiviral or anticancer activities, depending on its interactions within biological systems. Its molecular structure suggests it could participate in hydrogen bonding and other interactions relevant to nucleic acid chemistry. Additionally, the presence of the methylsulfanyl group may affect its metabolic stability and bioavailability. Overall, this compound is of interest in medicinal chemistry and biochemistry for its potential applications in therapeutic development.

Formula: C₁₁H₁₅N₅O₃S

InChI: InChI=1/C11H15N5O3S/c1-20-10-8-9(14-11(12)15-10)16(4-13-8)7-2-5(18)6(3-17)19-7/h4-7,17-18H,2-3H2,1H3,(H2,12,14,15)

SMILES: CSc1c2c([nH]c(=N)n1)n(cn2)C1CC(C(CO)O1)O

2'-Deoxy-6-methylthioguanosine

CAS: 37113-42-1

2'-Deoxy-6-methylthioguanosine is a novel nucleoside and nucleotide analog with antiviral and anticancer activities. It has been shown to inhibit the replication of DNA by inhibiting the activity of DNA polymerase. The target of this drug is not related to any virus or bacterial species, but it inhibits the growth of cancer cells in vitro. The synthesis of 2'-deoxy-6-methylthioguanosine can be achieved by modifying commercially available phosphoramidites.

Formula: C₁₁H₁₅N₅O₃S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 297.33 g/mol

Ref: 3D-ND71741