CAS 37116-82-8: 5,10,15,20-Tetrakis(2-nitrophenyl)-21H,23H-porphine
Description:5,10,15,20-Tetrakis(2-nitrophenyl)-21H,23H-porphine is a synthetic porphyrin derivative characterized by its complex structure, which includes a porphyrin core substituted with four 2-nitrophenyl groups. This compound exhibits notable optical properties, particularly strong absorption in the visible region due to its conjugated π-electron system, making it useful in various applications such as photodynamic therapy and as a dye in solar energy conversion. The presence of nitro groups enhances its electron-withdrawing characteristics, which can influence its reactivity and interaction with other molecules. Additionally, the compound's solubility can vary depending on the solvent, and it may exhibit distinct behavior in different chemical environments. Its unique structure and properties make it a subject of interest in materials science and organic chemistry research, particularly in the development of functional materials and sensors. Overall, 5,10,15,20-Tetrakis(2-nitrophenyl)-21H,23H-porphine is a versatile compound with significant potential in various scientific fields.
Formula:C44H26N8O8
InChI:InChI=1S/C44H26N8O8/c53-49(54)37-13-5-1-9-25(37)41-29-17-19-31(45-29)42(26-10-2-6-14-38(26)50(55)56)33-21-23-35(47-33)44(28-12-4-8-16-40(28)52(59)60)36-24-22-34(48-36)43(32-20-18-30(41)46-32)27-11-3-7-15-39(27)51(57)58/h1-24,45,48H/b41-29-,41-30?,42-31-,42-33?,43-32-,43-34?,44-35-,44-36?
InChI key:InChIKey=OQFXLKPXTVQULX-AEEHFBSRSA-N
SMILES:O=N(=O)C=1C=CC=CC1C2=C3N=C(C=C3)C(=C4C=CC(N4)=C(C5=NC(C=C5)=C(C6=CC=C2N6)C7=CC=CC=C7N(=O)=O)C8=CC=CC=C8N(=O)=O)C9=CC=CC=C9N(=O)=O
- Synonyms:
- 5,10,15,20-Tetrakis(2-nitrophenyl)-21H,23H-porphine
- meso-5,10,15,20-Tetrakis(o-nitrophenyl)porphyrin
- α,β,γ,δ-Tetra(o-nitrophenyl)porphine
- 21H,23H-Porphine, 5,10,15,20-tetrakis(2-nitrophenyl)-
- meso-Tetra(o-nitrophenyl)porphyrin
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | meso-Tetra(2-nitrophenyl) porphine REF: FT-T40762CAS: 37116-82-8 | >95% | To inquire | Mon 21 Apr 25 |
![]() | 5,10,15,20-Tetrakis(2-nitrophenyl)porphyrin REF: 3D-MBA11682CAS: 37116-82-8 | Min. 95% | - - - | Discontinued product |

meso-Tetra(2-nitrophenyl) porphine
Ref: FT-T40762
1g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire | ||
500mg | To inquire |

5,10,15,20-Tetrakis(2-nitrophenyl)porphyrin
Ref: 3D-MBA11682
500mg | Discontinued | Request information |