
CAS 371163-96-1
:Deep Purple
Description:
"Deep Purple" refers to a specific chemical substance identified by its CAS number 371163-96-1, which is a synthetic dye known for its vibrant purple color. This compound is part of the larger family of azo dyes, characterized by the presence of one or more azo groups (-N=N-) that link aromatic rings. Deep Purple exhibits excellent solubility in various organic solvents, making it suitable for applications in textiles, plastics, and inks. Its stability under light and heat contributes to its utility in various industrial applications. Additionally, like many azo dyes, it may undergo degradation under certain conditions, leading to potential environmental concerns. Safety data sheets typically indicate that while it is generally considered safe for use in controlled environments, appropriate handling and disposal measures should be observed to mitigate any health risks associated with exposure. Overall, Deep Purple serves as a notable example of synthetic colorants used in diverse applications, reflecting the intersection of chemistry and industry.
Formula:C23H22O7
InChI:InChI=1S/C23H22O7/c1-3-4-5-6-7-8-15(25)11-19(26)20-18-10-14-9-16(12-24)29-13-17(14)21(27)23(18,2)30-22(20)28/h3-8,10-11,13,16,24,26H,9,12H2,1-2H3/b4-3+,6-5+,8-7+,19-11-/t16-,23-/m0/s1
InChI key:InChIKey=JKMBMIMLVFMXRW-LYYFRFARSA-N
SMILES:C[C@@]12C(=C(\C(=C\C(/C=C/C=C/C=C/C)=O)\O)C(=O)O1)C=C3C(C2=O)=CO[C@H](CO)C3
Synonyms:- Epicocconone
- 2H-Furo[3,2-g][2]benzopyran-2,9(9aH)-dione, 5,6-dihydro-6-(hydroxymethyl)-3-[(1Z,4E,6E,8E)-1-hydroxy-3-oxo-1,4,6,8-decatetraenyl]-9a-methyl-, (6S,9aS)-
- (6S,9aS)-5,6-Dihydro-6-(hydroxymethyl)-3-[(1Z,4E,6E,8E)-1-hydroxy-3-oxo-1,4,6,8-decatetraen-1-yl]-9a-methyl-2H-furo[3,2-g][2]benzopyran-2,9(9aH)-dione
- 2H-Furo[3,2-g][2]benzopyran-2,9(9aH)-dione, 5,6-dihydro-6-(hydroxymethyl)-3-[(1Z,4E,6E,8E)-1-hydroxy-3-oxo-1,4,6,8-decatetraen-1-yl]-9a-methyl-, (6S,9aS)-
- Lightning Fast Protein Gel Stain
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Epicocconone
CAS:Epicocconone is a fluorescent compound comes from the fungus epicoccumnigrum.Formula:C23H22O7Color and Shape:SolidMolecular weight:410.42
