CymitQuimica logo

CAS 37128-24-8

:

ethyl (2-methyl-1,3-thiazol-4-yl)acetate

Description:
Ethyl (2-methyl-1,3-thiazol-4-yl)acetate is an organic compound characterized by its thiazole ring structure, which contributes to its unique chemical properties. It features an ethyl acetate moiety, making it an ester, and the presence of a thiazole ring introduces heteroatoms, specifically sulfur and nitrogen, into its structure. This compound is typically a colorless to pale yellow liquid with a characteristic odor, often associated with its ester functionality. It is soluble in organic solvents and has limited solubility in water due to its hydrophobic ethyl group. Ethyl (2-methyl-1,3-thiazol-4-yl)acetate is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its thiazole component may impart antimicrobial or antifungal properties, making it a candidate for further research in medicinal chemistry. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with exposure.
Formula:C8H11NO2S
InChI:InChI=1/C8H11NO2S/c1-3-11-8(10)4-7-5-12-6(2)9-7/h5H,3-4H2,1-2H3
InChI key:DWSMURKWFWKPBT-UHFFFAOYSA-N
SMILES:CCOC(=O)Cc1csc(C)n1
Synonyms:
  • (2-Methyl-thiazol-4-yl)-acetic acid ethyl ester
  • 4-Thiazoleacetic acid, 2-methyl-, ethyl ester
  • Ethyl 2-(2-methyl-1,3-thiazol-4-yl)acetate
  • Ethyl (2-methyl-1,3-thiazol-4-yl)acetate
Found 5 products.