CAS 37131-87-6
:5-Bromopyrimidine-2-carboxylic acid
Description:
5-Bromopyrimidine-2-carboxylic acid is a heterocyclic organic compound characterized by the presence of a bromine atom and a carboxylic acid functional group attached to a pyrimidine ring. This compound features a pyrimidine structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The bromine substituent is located at the 5-position, while the carboxylic acid group is at the 2-position, contributing to its acidic properties. The presence of these functional groups makes it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. It is typically a white to off-white solid and is soluble in polar solvents. The compound exhibits typical reactivity associated with carboxylic acids, such as undergoing esterification and amide formation. Additionally, the bromine atom can participate in nucleophilic substitution reactions, enhancing its utility in various chemical transformations. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C5H3BrN2O2
InChI:InChI=1/C5H3BrN2O2/c6-3-1-7-4(5(9)10)8-2-3/h1-2H,(H,9,10)
SMILES:c1c(cnc(C(=O)O)n1)Br
Synonyms:- 2-Pyrimidinecarboxylic acid, 5-bromo-
- 5-Bromo-2-pyrimidinecarboxylic acid
- T6N Cnj Bvq Ee [Wln]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Bromopyrimidine-2-carboxylic acid, 98%
CAS:5-Bromopyrimidine-2-carboxylic acid is employed as a important raw material and intermediate used in organic synthesis agrochemical, pharmaceutical and dyestuff field. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and labeFormula:C5H3BrN2O2Purity:98%Molecular weight:203.005-Bromopyrimidine-2-carboxylic acid
CAS:Formula:C5H3BrN2O2Purity:97%Color and Shape:SolidMolecular weight:202.99355-Bromopyrimidine-2-carboxylic acid
CAS:5-Bromopyrimidine-2-carboxylic acidPurity:97%Color and Shape:White SolidMolecular weight:202.99g/mol5-Bromopyrimidine-2-carboxylic acid
CAS:Formula:C5H3BrN2O2Purity:95%Color and Shape:Solid, PowderMolecular weight:202.995



