CAS 37131-91-2

6-Chloro-4-pyrimidinecarboxylic acid

Description:

6-Chloro-4-pyrimidinecarboxylic acid is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a chlorine atom and a carboxylic acid functional group. The presence of the chlorine atom at the 6-position of the pyrimidine ring contributes to its reactivity and potential applications in medicinal chemistry and agrochemicals. The carboxylic acid group at the 4-position enhances its solubility in polar solvents and can participate in various chemical reactions, such as esterification and amidation. This compound is often utilized as an intermediate in the synthesis of pharmaceuticals and other biologically active molecules. Its structural features allow for the formation of hydrogen bonds, which can influence its biological activity and interactions with other molecules. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the substance. Overall, 6-Chloro-4-pyrimidinecarboxylic acid is a valuable compound in organic synthesis and drug development.

Formula: C₅H₃ClN₂O₂

InChI: InChI=1/C5H3ClN2O2/c6-4-1-3(5(9)10)7-2-8-4/h1-2H,(H,9,10)

InChI key: InChIKey=RWSPRTBXAXZIOS-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(Cl)N=CN1

Synonyms:

• 4-Pyrimidinecarboxylic Acid, 6-Chloro-
• 6-Chloro-4-pyrimidinecarboxylicacid
• 6-Chloro-4-Pyrimidinecarboxylic Acid
• 6-Chlor-pyrimidin-4-carbonsaeure
• 6-Chloropyrimidine-4-carboxylic acid 97%
• 6-chloropyrimidine-4-carboxylic acid
• 6-Chloro-pyrimidin-4-carboxylic acid
• 6-Chloro-4-pyrimidinecarboxylic acid ISO 9001：2015 REACH

6-Chloro-4-pyrimidinecarboxylic acid

CAS: 37131-91-2

Formula: C₅H₃ClN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 158.5425

Ref: IN-DA00C6WX

6-Chloropyrimidine-4-carboxylic acid

CAS: 37131-91-2

6-Chloropyrimidine-4-carboxylic acid

Purity: 97%

Molecular weight: 158.54g/mol

Ref: 54-OR52384

6-Chloro-4-pyrimidinecarboxylic acid

CAS: 37131-91-2

Formula: C₅H₃ClN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 158.54

Ref: 10-F077265