CAS 37136-84-8
:1-bromo-2-(3-bromopropoxy)benzene
Description:
1-Bromo-2-(3-bromopropoxy)benzene, with the CAS number 37136-84-8, is an organic compound characterized by its aromatic structure, which includes a bromobenzene moiety and a propoxy group substituted at the ortho position. This compound features two bromine atoms, which contribute to its reactivity and potential applications in organic synthesis and materials science. The presence of the propoxy group enhances its solubility in organic solvents, making it useful in various chemical reactions. Its molecular structure suggests that it may exhibit interesting physical properties, such as moderate boiling and melting points, typical of halogenated aromatic compounds. Additionally, the bromine substituents can influence its electronic properties, potentially making it a candidate for use in pharmaceuticals or as an intermediate in the synthesis of more complex molecules. Safety considerations should be taken into account due to the presence of bromine, which can be hazardous. Overall, 1-bromo-2-(3-bromopropoxy)benzene is a versatile compound with potential applications in both research and industry.
Formula:C9H10Br2O
InChI:InChI=1/C9H10Br2O/c10-6-3-7-12-9-5-2-1-4-8(9)11/h1-2,4-5H,3,6-7H2
SMILES:c1ccc(c(c1)Br)OCCCBr
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
