CAS 37159-60-7

3-bromo-1,2,4-thiadiazol-5-amine

Description:

3-Bromo-1,2,4-thiadiazol-5-amine is a heterocyclic compound characterized by the presence of a thiadiazole ring, which consists of two nitrogen atoms and one sulfur atom in a five-membered ring structure. The compound features a bromine substituent at the 3-position and an amino group at the 5-position, contributing to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. The presence of the bromine atom can enhance its electrophilic character, making it useful in nucleophilic substitution reactions. Additionally, the amino group can participate in hydrogen bonding, influencing its interactions with biological targets. The compound's unique structure allows for diverse chemical modifications, which can lead to the development of derivatives with tailored properties. Overall, 3-bromo-1,2,4-thiadiazol-5-amine is of interest for its potential utility in synthetic chemistry and medicinal applications.

Formula: C₂BrClN₂S

InChI: InChI=1/C2BrClN2S/c3-1-5-2(4)7-6-1

SMILES: c1(Br)nc(Cl)sn1

Synonyms:

• 1,2,4-Thiadiazole, 3-bromo-5-chloro-
• 3-Bromo-5-Chloro-1,2,4-Thiadiazole
• 3-BroMo-5-chloro-1,2,4-thiadiazole, 97% 10GR
• 3-Bromo-5-chloro-1,2,4-thiadiazole,97%

3-Bromo-5-chloro-1,2,4-thiadiazole

CAS: 37159-60-7

Formula: C₂BrClN₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 199.4568

Ref: IN-DA0038SG

3-Bromo-5-chloro-1,2,4-thiadiazole

CAS: 37159-60-7

3-Bromo-5-chloro-1,2,4-thiadiazole

Formula: C₂BrClN₂S

Purity: ≥95%

Color and Shape: clear. almost colourless liquid

Molecular weight: 199.4568g/mol

Ref: 54-OR9538

3-Bromo-5-chloro-1,2,4-thiadiazole

CAS: 37159-60-7

Formula: C₂BrClN₂S

Purity: 97.0%

Color and Shape: Low Melting Solid

Molecular weight: 199.45

Ref: 10-F005949