CAS 3717-21-3
:(E)-4-Methoxybenzaldehyde oxime
Description:
(E)-4-Methoxybenzaldehyde oxime, with the CAS number 3717-21-3, is an organic compound characterized by its oxime functional group attached to a methoxy-substituted benzaldehyde. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and conditions. It has a distinctive aromatic odor due to the presence of the benzaldehyde moiety. The oxime functional group, characterized by the structure R1R2C=NOH, contributes to its reactivity, particularly in condensation reactions and as a potential ligand in coordination chemistry. The methoxy group enhances the compound's solubility in organic solvents and can influence its reactivity and interaction with other chemical species. (E)-4-Methoxybenzaldehyde oxime is often used in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Safety precautions should be observed when handling this compound, as with many organic chemicals.
Formula:C8H9NO2
InChI:InChI=1S/C8H9NO2/c1-11-8-4-2-7(3-5-8)6-9-10/h2-6,10H,1H3/b9-6+
InChI key:InChIKey=FXOSHPAYNZBSFO-RMKNXTFCSA-N
SMILES:C(=N/O)\C1=CC=C(OC)C=C1
Synonyms:- NSC 136033
- (E)-4-Methoxybenzaldehyde oxime
- p-Anisaldehyde,oxime, (E)- (8CI)
- (E)-p-Methoxybenzaldehyde oxime
- p-Anisaldehyde, oxime, (E)-
- (E)-p-Methoxybenzaldehyde oxime
- (E)-4-Methoxybenzaldoxime
- (E)-4-Methoxybenzaldoxime
- Benzaldehyde, 4-methoxy-, oxime, (E)-
- (E)-4-Methoxybenzaldehyde oxime
- trans-4-Methoxybenzaldehyde oxime
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(E)-4-Methoxybenzaldehyde oxime
CAS:Formula:C8H9NO2Purity:97%Color and Shape:SolidMolecular weight:151.16264-Methoxybenzaldehyde oxime
CAS:4-Methoxybenzaldehyde oxime is a chemical compound that reacts with polyvinyl chloride to form polyvinyl pyrrolidone. It can be used as a dehydrating agent in the reaction of alcohols, amines, and thiols. 4-Methoxybenzaldehyde oxime has been shown to react with picolinic acid to form an aldoxime. The optical properties of 4-methoxybenzaldehyde oxime are similar to those of chloroform. This compound reacts with chloride ions and methyl ethyl alcohol to form an organic solution that contains carbonyl groups and functional groups.
Formula:C8H9NO2Purity:Min. 95%Molecular weight:151.16 g/mol


