CAS 37174-98-4

Hexanoic acid, 5,5-dimethyl-4-oxo-, ethyl ester

Description:

Hexanoic acid, 5,5-dimethyl-4-oxo-, ethyl ester, with the CAS number 37174-98-4, is an organic compound characterized by its ester functional group derived from hexanoic acid and a ketone structure. This compound typically exhibits a moderate boiling point and is likely to be a colorless to pale yellow liquid at room temperature. It is soluble in organic solvents, reflecting its ester nature, while its solubility in water is limited due to the hydrophobic hexanoic acid chain. The presence of the 5,5-dimethyl-4-oxo substituent contributes to its unique reactivity and potential applications in organic synthesis, particularly in the production of fragrances, flavoring agents, or as intermediates in chemical reactions. Additionally, its structure suggests potential for various chemical transformations, making it of interest in both industrial and research settings. Safety data should be consulted for handling and exposure guidelines, as with all chemical substances.

Formula: C₁₀H₁₈O₃

InChI: InChI=1S/C10H18O3/c1-5-13-9(12)7-6-8(11)10(2,3)4/h5-7H2,1-4H3

InChI key: InChIKey=FUCPUODHDLBLAU-UHFFFAOYSA-N

SMILES: C(CCC(OCC)=O)(C(C)(C)C)=O

Synonyms:

• Hexanoic acid, 5,5-dimethyl-4-oxo-, ethyl ester
• Ethyl 5,5-dimethyl-4-oxohexanoate

Ethyl 5,5-dimethyl-4-oxohexanoate

CAS: 37174-98-4

Formula: C₁₀H₁₈O₃

Purity: 97.0%

Molecular weight: 186.251

Ref: 10-F207850

Ethyl 5,5-dimethyl-4-oxohexanoate

CAS: 37174-98-4

Versatile small molecule scaffold

Formula: C₁₀H₁₈O₃

Purity: Min. 95%

Molecular weight: 186.25 g/mol

Ref: 3D-MBA17498