CAS 37182-75-5

1-(3-Carboxyphenyl)-2-thiourea

Description:

1-(3-Carboxyphenyl)-2-thiourea, with the CAS number 37182-75-5, is an organic compound characterized by the presence of a thiourea functional group and a carboxyphenyl moiety. This compound typically exhibits properties associated with both thioureas and carboxylic acids, such as potential solubility in polar solvents due to the carboxylic acid group. It may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, owing to the reactivity of the thiourea group. The presence of the carboxylic acid functional group can also influence its acidity and ability to form salts. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical and agricultural research. Its structural features suggest potential applications in the synthesis of more complex molecules or as a reagent in organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications and handling guidelines.

Formula: C₈H₇N₂O₂S

InChI: InChI=1/C8H8N2O2S/c9-8(13)10-6-3-1-2-5(4-6)7(11)12/h1-4H,(H,11,12)(H3,9,10,13)/p-1

SMILES: c1cc(cc(c1)NC(=N)S)C(=O)[O-]

Synonyms:

• 3-(Carbamothioylamino)Benzoic Acid
• 3-(Carbamothioylamino)Benzoate

3-Thioureidobenzoic acid

CAS: 37182-75-5

Formula: C₈H₈N₂O₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 196.2263

Ref: IN-DA003CWM

1-(3-Carboxyphenyl)-2-thiourea

CAS: 37182-75-5

1-(3-Carboxyphenyl)-2-thiourea

Purity: 95%

Molecular weight: 196.23g/mol

Ref: 54-OR322056

1-(3-Carboxyphenyl)-2-thiourea

CAS: 37182-75-5

Formula: C₈H₈N₂O₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 196.22

Ref: 10-F018351

1-(3-Carboxyphenyl)-2-thiourea

CAS: 37182-75-5

3-Carboxyphenylthiourea (3CPTU) is a drug that inhibits tyrosine kinase, and is a potential therapeutic for chronic myeloid leukemia. 3CPTU has been shown to inhibit the bcr-abl protein in chronic myeloid leukemia cells, which leads to cell death. This drug also has excellent adsorption properties and can be used as an adsorbent material to remove organic pollutants from wastewater. 3CPTU can be recycled by washing with water and regenerating it with a strong base. This process can be repeated up to 10 times without any significant loss of adsorption capacity. The equilibrium constants are dependent on the pH of the solution and temperature, so the adsorption mechanism changes with pH and temperature.

Formula: C₈H₈N₂O₂S

Purity: Min. 95%

Molecular weight: 196.23 g/mol

Ref: 3D-FC168827