CAS 3719-45-7
:1-methyl-6-oxo-1,6-dihydropyridine-3-carboxylic acid
Description:
1-Methyl-6-oxo-1,6-dihydropyridine-3-carboxylic acid, with the CAS number 3719-45-7, is a heterocyclic organic compound characterized by its pyridine ring structure, which includes a methyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with both pyridine derivatives and carboxylic acids, such as moderate solubility in polar solvents like water and alcohols, and potential acidity due to the carboxylic acid group. The presence of the keto group contributes to its reactivity, allowing for various chemical transformations. It may participate in reactions typical of pyridine derivatives, including nucleophilic substitutions and condensation reactions. Additionally, this compound may have biological significance, as many pyridine derivatives are known for their pharmacological activities. Its structural features suggest potential applications in medicinal chemistry and organic synthesis, although specific applications would depend on further research into its biological activity and reactivity.
Formula:C7H7NO3
InChI:InChI=1/C7H7NO3/c1-8-4-5(7(10)11)2-3-6(8)9/h2-4H,1H3,(H,10,11)
SMILES:Cn1cc(ccc1=O)C(=O)O
Synonyms:- 3-Pyridinecarboxylic acid, 1,6-dihydro-1-methyl-6-oxo-
- 1-Methyl-6-Pyridone-3-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
1-Methyl-6-oxo-1,6-dihydropyridine-3-carboxylic acid
CAS:Formula:C7H7NO3Purity:98%Color and Shape:SolidMolecular weight:153.1354Ref: IN-DA003EID
1g26.00€5g52.00€10g68.00€25g129.00€100g363.00€250gTo inquire500gTo inquire250mg22.00€N-Methyl-2-Pyridone 5-Carboxylic Acid
CAS:Formula:C7H7NO3Color and Shape:Pale Yellow SolidMolecular weight:153.141,2-Dihydro-1-methyl-2-oxopyridine-5-carboxylic acid
CAS:1,2-Dihydro-1-methyl-2-oxopyridine-5-carboxylic acidPurity:98%Molecular weight:153.13538g/molNudifloric Acid
CAS:1-Methyl-6-oxo-1,6-dihydropyridine-3-carboxylic acid (Nudifloric Acid) is from Cordyceps bassiana. Nudifloric Acid has an anti-inflammatory function.Formula:C7H7NO3Purity:99.55%Color and Shape:SolidMolecular weight:153.141-Methyl-6-oxo-1,6-dihydro-pyridine-3-carboxylic acid
CAS:Formula:C7H7NO3Purity:95%Color and Shape:SolidMolecular weight:153.137Nudifloric Acid
CAS:Controlled Product<p>Applications A metabolite of Tryptophan-niacin.<br>References Yuyama, S. et al.: Adv. Exp. Med. Biol. 294, 475 (1991).<br></p>Formula:C7H7NO3Color and Shape:NeatMolecular weight:153.14







