CAS 371917-16-7: 1-(Trifluoromethyl)cyclobutanemethanol
Description:1-(Trifluoromethyl)cyclobutanemethanol is an organic compound characterized by the presence of a cyclobutane ring substituted with a trifluoromethyl group and a hydroxymethyl group. The trifluoromethyl group (-CF3) is known for its electron-withdrawing properties, which can significantly influence the reactivity and polarity of the molecule. The cyclobutane structure contributes to the compound's unique three-dimensional conformation, potentially affecting its physical and chemical properties, such as boiling point and solubility. The hydroxymethyl group (-CH2OH) introduces a functional site that can participate in hydrogen bonding, enhancing the compound's solubility in polar solvents. This compound may exhibit interesting biological activities due to the presence of both the trifluoromethyl and hydroxymethyl groups, making it a subject of interest in medicinal chemistry and material science. Its specific applications and reactivity would depend on the context of its use, including potential roles in synthesis or as a precursor in various chemical reactions.
Formula:C6H9F3O
InChI:InChI=1S/C6H9F3O/c7-6(8,9)5(4-10)2-1-3-5/h10H,1-4H2
InChI key:InChIKey=UQSIEHVSHVIAPB-UHFFFAOYSA-N
SMILES:FC(F)(F)C1(CO)CCC1
- Synonyms:
- 1-(Trifluoromethyl)cyclobutanemethanol
- 1-Hydroxymethyl-1-(trifluoromethyl)cyclobutane
- Cyclobutanemethanol, 1-(trifluoromethyl)-
- [1-(Trifluoromethyl)cyclobutyl]methanol

1-HydroxyMethyl-1-(trifluoroMethyl)cyclobutane
Ref: IN-DA00CKN8
1g | 619.00 € | ||
100mg | 144.00 € | ||
250mg | 176.00 € | ||
500mg | 292.00 € |

[1-(TRIFLUOROMETHYL)CYCLOBUTYL]METHANOL
Ref: 10-F501473
1g | 533.00 € | ||
100mg | 136.00 € | ||
250mg | 222.00 € |

[1-(Trifluoromethyl)cyclobutyl]methanol
Ref: 3D-WPA91716
50mg | 595.00 € | ||
500mg | 1,640.00 € |