CAS 371942-69-7: 6-Amino-N-[3-[4-(4-morpholinyl)pyrido[3',2':4,5]furo[3,2-d]pyrimidin-2-yl]phenyl]-3-pyridinecarboxamide
Description:6-Amino-N-[3-[4-(4-morpholinyl)pyrido[3',2':4,5]furo[3,2-d]pyrimidin-2-yl]phenyl]-3-pyridinecarboxamide, with CAS number 371942-69-7, is a chemical compound characterized by its complex structure, which includes multiple aromatic rings and functional groups. This compound features an amino group, a carboxamide moiety, and a morpholine ring, contributing to its potential biological activity. The presence of pyridine and pyrimidine rings suggests that it may interact with biological targets, possibly serving as a pharmaceutical agent. Its molecular structure indicates potential for hydrogen bonding and π-π stacking interactions, which are important for binding to biological macromolecules. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. Overall, this compound's intricate design may position it as a candidate for further research in medicinal chemistry, particularly in the development of targeted therapies.
Formula:C25H21N7O3
InChI:InChI=1S/C25H21N7O3/c26-19-7-6-16(14-28-19)24(33)29-17-4-1-3-15(13-17)22-30-20-18-5-2-8-27-25(18)35-21(20)23(31-22)32-9-11-34-12-10-32/h1-8,13-14H,9-12H2,(H2,26,28)(H,29,33)