CAS 371942-69-7

6-Amino-N-[3-[4-(4-morpholinyl)pyrido[3',2':4,5]furo[3,2-d]pyrimidin-2-yl]phenyl]-3-pyridinecarboxamide

Description:

6-Amino-N-[3-[4-(4-morpholinyl)pyrido[3',2':4,5]furo[3,2-d]pyrimidin-2-yl]phenyl]-3-pyridinecarboxamide, with CAS number 371942-69-7, is a chemical compound characterized by its complex structure, which includes multiple aromatic rings and functional groups. This compound features an amino group, a carboxamide moiety, and a morpholine ring, contributing to its potential biological activity. The presence of pyridine and pyrimidine rings suggests that it may interact with biological targets, possibly serving as a pharmaceutical agent. Its molecular structure indicates potential for hydrogen bonding and π-π stacking interactions, which are important for binding to biological macromolecules. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. Overall, this compound's intricate design may position it as a candidate for further research in medicinal chemistry, particularly in the development of targeted therapies.

Formula: C₂₅H₂₁N₇O₃

InChI: InChI=1S/C25H21N7O3/c26-19-7-6-16(14-28-19)24(33)29-17-4-1-3-15(13-17)22-30-20-18-5-2-8-27-25(18)35-21(20)23(31-22)32-9-11-34-12-10-32/h1-8,13-14H,9-12H2,(H2,26,28)(H,29,33)

SMILES: c1cc(cc(c1)N=C(c1ccc(=N)[nH]c1)O)c1nc2c3cccnc3oc2c(n1)N1CCOCC1

Synonyms:

• Ym 201636

YM201636

CAS: 371942-69-7

Formula: C₂₅H₂₁N₇O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 467.4793

Ref: IN-DA00BYHS

YM-201636

CAS: 371942-69-7

YM-201636

Purity: ≥90%

Molecular weight: 467.48g/mol

Ref: 54-BUP08464

YM201636 hydrochloride

CAS: 371942-69-7

Ref: 7W-GW7605

YM-201636

CAS: 371942-69-7

YM201636 (IC50=33 nM), a specific PIKfyve inhibitor, is less effective to p110α and insensitive to Fabl, which is yeast orthologue.

Formula: C₂₅H₂₁N₇O₃

Purity: 93.28% - 98.3%

Color and Shape: Solid

Molecular weight: 467.48

Ref: TM-T6110